N-[2-(4-hydroxyphenyl)ethyl]deca-2,4-dienamide
Internal ID | e5457357-d8dc-4105-b3c0-e32a22673ef1 |
Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]deca-2,4-dienamide |
SMILES (Canonical) | CCCCCC=CC=CC(=O)NCCC1=CC=C(C=C1)O |
SMILES (Isomeric) | CCCCCC=CC=CC(=O)NCCC1=CC=C(C=C1)O |
InChI | InChI=1S/C18H25NO2/c1-2-3-4-5-6-7-8-9-18(21)19-15-14-16-10-12-17(20)13-11-16/h6-13,20H,2-5,14-15H2,1H3,(H,19,21) |
InChI Key | LNWXDGQUTGHICD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H25NO2 |
Molecular Weight | 287.40 g/mol |
Exact Mass | 287.188529040 g/mol |
Topological Polar Surface Area (TPSA) | 49.30 Ų |
XlogP | 4.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.08% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.22% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.14% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.13% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.65% | 94.45% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.94% | 92.08% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.53% | 96.95% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.43% | 96.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.29% | 94.73% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.33% | 89.33% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.92% | 97.29% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.66% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.16% | 86.33% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.16% | 100.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.28% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.55% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea millefolium |
Anacyclus pyrethrum |
PubChem | 72731317 |
LOTUS | LTS0109286 |
wikiData | Q105154553 |