N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodecanamide
| Internal ID | c2aaa19a-ec53-4f31-8035-5a1147bb3a83 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodecanamide |
| SMILES (Canonical) | CCCCCCCCCC(C)CC(=O)NCCC1=CC=C(C=C1)O |
| SMILES (Isomeric) | CCCCCCCCCC(C)CC(=O)NCCC1=CC=C(C=C1)O |
| InChI | InChI=1S/C21H35NO2/c1-3-4-5-6-7-8-9-10-18(2)17-21(24)22-16-15-19-11-13-20(23)14-12-19/h11-14,18,23H,3-10,15-17H2,1-2H3,(H,22,24) |
| InChI Key | QMMWRYRRTSIBHU-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.266779359 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 6.70 |
| There are no found synonyms. |
![2D Structure of N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodecanamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-4-hydroxyphenylethyl-3-methyldodecanamide.jpg "2D Structure of N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodecanamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.41% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.67% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.82% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.29% | 96.09% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 93.03% | 89.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.95% | 94.45% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 92.00% | 96.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.74% | 90.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.67% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.50% | 91.11% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 90.14% | 94.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.82% | 97.79% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.36% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.82% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.38% | 92.08% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.08% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.94% | 93.56% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.84% | 92.86% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.66% | 97.21% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.12% | 97.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.64% | 98.75% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.91% | 89.63% |
| CHEMBL268 | P43235 | Cathepsin K | 83.68% | 96.85% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.72% | 92.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.13% | 96.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.28% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Physochlaina alaica |
| PubChem | 16091484 |
| LOTUS | LTS0232018 |
| wikiData | Q105007293 |