N-[2-[4-(3-oxobutoxy)phenyl]ethyl]benzamide
| Internal ID | ec3c563b-3c5d-4bd9-aff3-b80b410eeb85 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-[2-[4-(3-oxobutoxy)phenyl]ethyl]benzamide |
| SMILES (Canonical) | CC(=O)CCOC1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2 |
| SMILES (Isomeric) | CC(=O)CCOC1=CC=C(C=C1)CCNC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C19H21NO3/c1-15(21)12-14-23-18-9-7-16(8-10-18)11-13-20-19(22)17-5-3-2-4-6-17/h2-10H,11-14H2,1H3,(H,20,22) |
| InChI Key | YGGUVPJVOHWWNU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.15214353 g/mol |
| Topological Polar Surface Area (TPSA) | 55.40 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of N-[2-[4-(3-oxobutoxy)phenyl]ethyl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-4-3-oxobutoxyphenylethylbenzamide.jpg "2D Structure of N-[2-[4-(3-oxobutoxy)phenyl]ethyl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.61% | 99.17% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 96.51% | 92.51% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 96.11% | 81.11% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 94.46% | 89.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.15% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.92% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.70% | 94.62% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 93.49% | 96.67% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.94% | 90.17% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 91.94% | 87.67% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 91.26% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.43% | 94.73% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.62% | 92.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.92% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.75% | 98.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.72% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.63% | 90.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.02% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.79% | 96.00% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 81.48% | 98.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.87% | 89.34% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.87% | 93.81% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Swinglea glutinosa |
| PubChem | 162982232 |
| LOTUS | LTS0095853 |
| wikiData | Q105348078 |