N-[2-(3,5-diiodo-4-methoxyphenyl)ethyl]benzamide
| Internal ID | a31f9fa6-f296-41d9-b388-3dbdf4ef398f |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-[2-(3,5-diiodo-4-methoxyphenyl)ethyl]benzamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H15I2NO2/c1-21-15-13(17)9-11(10-14(15)18)7-8-19-16(20)12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3,(H,19,20) |
| InChI Key | XZYWUGRSKVQSGH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H15I2NO2 |
| Molecular Weight | 507.10 g/mol |
| Exact Mass | 506.91922 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of N-[2-(3,5-diiodo-4-methoxyphenyl)ethyl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-35-diiodo-4-methoxyphenylethylbenzamide.jpg "2D Structure of N-[2-(3,5-diiodo-4-methoxyphenyl)ethyl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.60% | 87.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.72% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.02% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.22% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.10% | 98.75% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.64% | 81.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.79% | 86.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.17% | 96.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.35% | 91.11% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.85% | 89.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.46% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.84% | 90.20% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.41% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.66% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.85% | 96.00% |
| CHEMBL5028 | O14672 | ADAM10 | 81.04% | 97.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.77% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102483165 |
| LOTUS | LTS0136837 |
| wikiData | Q105345261 |