N-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dimethoxybenzamide
| Internal ID | 92e51af2-ff46-4c43-b5ed-0851f0f63ede |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dimethoxybenzamide |
| SMILES (Canonical) | COC1=CC(=C(C=C1)OC)C(=O)NCCC2=CC(=C(C=C2)OC)OC |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)OC)C(=O)NCCC2=CC(=C(C=C2)OC)OC |
| InChI | InChI=1S/C19H23NO5/c1-22-14-6-8-16(23-2)15(12-14)19(21)20-10-9-13-5-7-17(24-3)18(11-13)25-4/h5-8,11-12H,9-10H2,1-4H3,(H,20,21) |
| InChI Key | ONOCRMIHFUYRLS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 66.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of N-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dimethoxybenzamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-34-dimethoxyphenylethyl-25-dimethoxybenzamide.jpg "2D Structure of N-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dimethoxybenzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 94.54% | 87.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.72% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.54% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.43% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.26% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.08% | 90.20% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 87.86% | 81.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.68% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.31% | 91.11% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.89% | 94.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 85.71% | 89.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.30% | 95.50% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.31% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.58% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.00% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.62% | 96.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.39% | 95.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.38% | 95.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.94% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.60% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper taiwanense |
| PubChem | 8624076 |
| LOTUS | LTS0108460 |
| wikiData | Q105194988 |