N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]ethyl]-3-methylsulfonylprop-2-enamide
Internal ID | a7fcf83e-8278-4d94-8c03-6c240ef5d9c6 |
Taxonomy | Benzenoids > Phenol ethers > Anisoles |
IUPAC Name | N-[2-[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]ethyl]-3-methylsulfonylprop-2-enamide |
SMILES (Canonical) | CC(=CCOC1=C(C=C(C=C1)CCNC(=O)C=CS(=O)(=O)C)OC)C |
SMILES (Isomeric) | CC(=CCOC1=C(C=C(C=C1)CCNC(=O)C=CS(=O)(=O)C)OC)C |
InChI | InChI=1S/C18H25NO5S/c1-14(2)8-11-24-16-6-5-15(13-17(16)23-3)7-10-19-18(20)9-12-25(4,21)22/h5-6,8-9,12-13H,7,10-11H2,1-4H3,(H,19,20) |
InChI Key | FPQKZLMPABOCHA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H25NO5S |
Molecular Weight | 367.50 g/mol |
Exact Mass | 367.14534407 g/mol |
Topological Polar Surface Area (TPSA) | 90.10 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.45% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.39% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.38% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.86% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.57% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.11% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 87.75% | 98.75% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.27% | 89.44% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.52% | 96.90% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 85.78% | 90.20% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.67% | 96.95% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.38% | 94.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.96% | 89.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.94% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.54% | 97.21% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.88% | 94.75% |
CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 81.15% | 89.76% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.78% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycosmis chlorosperma |
PubChem | 162987129 |
LOTUS | LTS0136704 |
wikiData | Q104999342 |