N-[2-(2,4-dibromo-5-methoxyphenyl)ethenyl]-1-methylpyrrolidine-2-carboxamide
| Internal ID | 524ea312-c81c-4c82-8f95-c3de31b02e2f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Proline and derivatives |
| IUPAC Name | N-[2-(2,4-dibromo-5-methoxyphenyl)ethenyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H18Br2N2O2/c1-19-7-3-4-13(19)15(20)18-6-5-10-8-14(21-2)12(17)9-11(10)16/h5-6,8-9,13H,3-4,7H2,1-2H3,(H,18,20) |
| InChI Key | DPCFPCPMRIZROA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18Br2N2O2 |
| Molecular Weight | 418.12 g/mol |
| Exact Mass | 417.97145 g/mol |
| Topological Polar Surface Area (TPSA) | 41.60 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.36% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.29% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.00% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.33% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.29% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.65% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.32% | 96.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.68% | 99.18% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.97% | 92.94% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.11% | 91.07% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.47% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.77% | 85.14% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.32% | 97.47% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.88% | 90.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.33% | 91.19% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.32% | 93.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.25% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.12% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72772739 |
| LOTUS | LTS0127884 |
| wikiData | Q104986417 |