N-(2-(1H-Indol-3-yl)ethyl)-N-methylformamide
Internal ID | 09947f61-f40f-4eb6-831d-1af4cde7fd65 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N-methylformamide |
SMILES (Canonical) | CN(CCC1=CNC2=CC=CC=C21)C=O |
SMILES (Isomeric) | CN(CCC1=CNC2=CC=CC=C21)C=O |
InChI | InChI=1S/C12H14N2O/c1-14(9-15)7-6-10-8-13-12-5-3-2-4-11(10)12/h2-5,8-9,13H,6-7H2,1H3 |
InChI Key | LRIGMDMBUHYZDM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H14N2O |
Molecular Weight | 202.25 g/mol |
Exact Mass | 202.110613074 g/mol |
Topological Polar Surface Area (TPSA) | 36.10 Ų |
XlogP | 2.00 |
54268-27-8 |
N-[2-(1H-Indol-3-yl)ethyl]-N-methylformamide |
DTXSID30565894 |
CS-0042237 |
![2D Structure of N-(2-(1H-Indol-3-yl)ethyl)-N-methylformamide 2D Structure of N-(2-(1H-Indol-3-yl)ethyl)-N-methylformamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2-1h-indol-3-ylethyl-n-methylformamide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.69% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.43% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.68% | 91.11% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 94.21% | 88.56% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 91.54% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.11% | 96.09% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 89.49% | 98.59% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.49% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.43% | 94.73% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.76% | 90.08% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.94% | 95.00% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.99% | 95.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.88% | 94.75% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.66% | 89.44% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.97% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyathobasis fruticulosa |
Virola sebifera |
PubChem | 14947718 |
LOTUS | LTS0105789 |
wikiData | Q82451222 |