N-(1-methoxy-4-methylpentan-2-yl)-2-methylhexa-2,4-dienamide
| Internal ID | bcd49445-1a24-44dc-8d08-bc0fd3c0b42c |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | N-(1-methoxy-4-methylpentan-2-yl)-2-methylhexa-2,4-dienamide |
| SMILES (Canonical) | CC=CC=C(C)C(=O)NC(CC(C)C)COC |
| SMILES (Isomeric) | CC=CC=C(C)C(=O)NC(CC(C)C)COC |
| InChI | InChI=1S/C14H25NO2/c1-6-7-8-12(4)14(16)15-13(10-17-5)9-11(2)3/h6-8,11,13H,9-10H2,1-5H3,(H,15,16) |
| InChI Key | WSESSQIXKXIOEF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.188529040 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.77% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.69% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.42% | 91.11% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.20% | 97.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.20% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.50% | 96.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.45% | 89.34% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.19% | 92.29% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.06% | 89.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.72% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.18% | 94.45% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.12% | 87.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.58% | 94.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.37% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.71% | 95.71% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.45% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.38% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.96% | 85.14% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.83% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162815364 |
| LOTUS | LTS0220259 |
| wikiData | Q104200581 |