N-{1-carboxy-1-[histidyl(methyl)amino]propan-2-yl}histidine
| Internal ID | b6fbb532-713c-48e3-af79-2c17d4684951 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | 2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]-methylamino]-3-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]butanoic acid |
| SMILES (Canonical) | CC(C(C(=O)O)N(C)C(=O)C(CC1=CN=CN1)N)NC(CC2=CN=CN2)C(=O)O |
| SMILES (Isomeric) | CC(C(C(=O)O)N(C)C(=O)C(CC1=CN=CN1)N)NC(CC2=CN=CN2)C(=O)O |
| InChI | InChI=1S/C17H25N7O5/c1-9(23-13(16(26)27)4-11-6-20-8-22-11)14(17(28)29)24(2)15(25)12(18)3-10-5-19-7-21-10/h5-9,12-14,23H,3-4,18H2,1-2H3,(H,19,21)(H,20,22)(H,26,27)(H,28,29) |
| InChI Key | LMUHIYQHLMCRNZ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H25N7O5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.19171692 g/mol |
| Topological Polar Surface Area (TPSA) | 190.00 Ų |
| XlogP | -6.20 |
| N-{1-carboxy-1-[histidyl(methyl)amino]propan-2-yl}histidine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.92% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.49% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.44% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.33% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.57% | 99.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.94% | 89.34% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.83% | 90.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.90% | 94.45% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 84.55% | 95.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.49% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.60% | 85.14% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.36% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 43588 |
| LOTUS | LTS0069080 |
| wikiData | Q82961716 |