N-(1-Benzyl-2-hydroxyethyl)carbamic acid benzyl ester
| Internal ID | 0e04513b-c1d9-49cb-a04c-828de034122b |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines > Amphetamines and derivatives |
| IUPAC Name | benzyl N-(1-hydroxy-3-phenylpropan-2-yl)carbamate |
| SMILES (Canonical) | C1=CC=C(C=C1)CC(CO)NC(=O)OCC2=CC=CC=C2 |
| SMILES (Isomeric) | C1=CC=C(C=C1)CC(CO)NC(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20) |
| InChI Key | WPOFMMJJCPZPAO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 2.80 |
| Cbz-DL-Phenylalaninol |
| N-(1-Benzyl-2-hydroxyethyl)carbamic acid benzyl ester |
| benzyl N-(1-hydroxy-3-phenylpropan-2-yl)carbamate |
| benzyl N-(1-hydroxy-3-phenyl-propan-2-yl)carbamate |
| MFCD00191138 |
| MFCD00191193 |
| Z-Phe-ol |
| NSC133422 |
| Z-D-Phe-ol |
| A-BENZYL-D-ALA |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.70% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.44% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.28% | 90.17% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.72% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.02% | 96.09% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.76% | 94.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.00% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.49% | 95.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.96% | 91.19% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.57% | 93.04% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.26% | 90.20% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.01% | 91.71% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.49% | 97.64% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.44% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 52361 |
| LOTUS | LTS0189654 |
| wikiData | Q104200498 |