N-[1-[4-(2-cyanoethoxy)phenyl]-1,3-dihydroxypropan-2-yl]formamide
| Internal ID | e2033690-f2a4-4ada-9ad3-71996c773dc2 |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | N-[1-[4-(2-cyanoethoxy)phenyl]-1,3-dihydroxypropan-2-yl]formamide |
| SMILES (Canonical) | C1=CC(=CC=C1C(C(CO)NC=O)O)OCCC#N |
| SMILES (Isomeric) | C1=CC(=CC=C1C(C(CO)NC=O)O)OCCC#N |
| InChI | InChI=1S/C13H16N2O4/c14-6-1-7-19-11-4-2-10(3-5-11)13(18)12(8-16)15-9-17/h2-5,9,12-13,16,18H,1,7-8H2,(H,15,17) |
| InChI Key | JJOCQIWGYDLOEN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11100700 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | -0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.38% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.27% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.95% | 99.17% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 92.45% | 92.51% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.86% | 96.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.24% | 94.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.96% | 90.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.73% | 86.92% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.45% | 94.73% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 86.85% | 94.97% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.98% | 98.95% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 84.93% | 89.67% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.58% | 96.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.50% | 98.75% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.66% | 93.81% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.12% | 96.47% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.76% | 89.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14482530 |
| LOTUS | LTS0226894 |
| wikiData | Q105129779 |