Myxalamid C
| Internal ID | df7e4a3b-1a97-4315-8e4d-b0c6cd7d81c0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Acyclic monoterpenoids |
| IUPAC Name | (2E,4E,6Z,8E,10E,12R,13R,14E)-13-hydroxy-N-[(2S)-1-hydroxypropan-2-yl]-2,10,12,14-tetramethylheptadeca-2,4,6,8,10,14-hexaenamide |
| SMILES (Canonical) | CCC=C(C)C(C(C)C=C(C)C=CC=CC=CC=C(C)C(=O)NC(C)CO)O |
| SMILES (Isomeric) | CC/C=C(\C)/[C@@H]([C@H](C)/C=C(\C)/C=C/C=C\C=C\C=C(/C)\C(=O)N[C@@H](C)CO)O |
| InChI | InChI=1S/C24H37NO3/c1-7-13-19(3)23(27)21(5)16-18(2)14-11-9-8-10-12-15-20(4)24(28)25-22(6)17-26/h8-16,21-23,26-27H,7,17H2,1-6H3,(H,25,28)/b9-8-,12-10+,14-11+,18-16+,19-13+,20-15+/t21-,22+,23+/m1/s1 |
| InChI Key | QGJPEZISMDKYLK-HSSWLXNDSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.27734404 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 5.20 |
| C12160 |
| CHEBI:31874 |
| DTXSID801102570 |
| Q27114702 |
| (2E,4E,6Z,8E,10E,12R,13R,14E)-13-hydroxy-N-[(1S)-2-hydroxy-1-methyl-ethyl]-2,10,12,14-tetramethyl-heptadeca-2,4,6,8,10,14-hexaenamide |
| (2E,4E,6Z,8E,10E,12R,13R,14E)-13-Hydroxy-N-[(1S)-2-hydroxy-1-methylethyl]-2,10,12,14-tetramethyl-2,4,6,8,10,14-heptadecahexaenamide |
| (2E,4E,6Z,8E,10E,12R,13R,14E)-13-HYDROXY-N-[(2S)-1-HYDROXYPROPAN-2-YL]-2,10,12,14-TETRAMETHYLHEPTADECA-2,4,6,8,10,14-HEXAENAMIDE |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.39% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.70% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.16% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.97% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.93% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.83% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.81% | 98.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.34% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.93% | 94.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.71% | 97.29% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.93% | 97.21% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.52% | 87.45% |
| CHEMBL3587 | Q02750 | Dual specificity mitogen-activated protein kinase kinase 1 | 82.22% | 97.93% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.93% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.90% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.78% | 91.19% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.97% | 80.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.42% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11954001 |
| LOTUS | LTS0073844 |
| wikiData | Q27114702 |