Myrigalone G
Internal ID | d9bdec99-d6d6-4b45-a00f-e65678271bcf |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
IUPAC Name | 1-(2,6-dihydroxy-4-methoxy-3-methylphenyl)-3-phenylpropan-1-one |
SMILES (Canonical) | CC1=C(C=C(C(=C1O)C(=O)CCC2=CC=CC=C2)O)OC |
SMILES (Isomeric) | CC1=C(C=C(C(=C1O)C(=O)CCC2=CC=CC=C2)O)OC |
InChI | InChI=1S/C17H18O4/c1-11-15(21-2)10-14(19)16(17(11)20)13(18)9-8-12-6-4-3-5-7-12/h3-7,10,19-20H,8-9H2,1-2H3 |
InChI Key | BMBFYUFAFGLKJJ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H18O4 |
Molecular Weight | 286.32 g/mol |
Exact Mass | 286.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 3.70 |
2',6'-Dihydroxy-4'-methoxy-3'-methyldihydrochalcone |
1-(2,6-Dihydroxy-4-methoxy-3-methylphenyl)-3-phenylpropan-1-one |
SCHEMBL14400965 |
CHEBI:174741 |
DTXSID101317978 |
1-(2,6-dihydroxy-4-methoxy-3-methyl-phenyl)-3-phenyl-propan-1-one |
LMPK12120493 |
83247-38-5 |
1-(2,6-Dihydroxy-4-methoxy-3-methylphenyl)-3-phenyl-1-propanone |
![2D Structure of Myrigalone G 2D Structure of Myrigalone G](https://plantaedb.com/storage/docs/compounds/2023/11/myrigalone-g.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.16% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.75% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.50% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.14% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 91.28% | 90.20% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.49% | 91.11% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.23% | 95.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.55% | 97.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.92% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 83.63% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.30% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.29% | 96.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.41% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.47% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.48% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leptospermum recurvum |
Myrica gale |
PubChem | 9947802 |
LOTUS | LTS0081915 |
wikiData | Q104938305 |