Myrciaphenone A
Internal ID | 64480b37-fa20-45cd-be4d-2846e3a525b6 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
SMILES (Canonical) | CC(=O)C1=C(C=C(C=C1OC2C(C(C(C(O2)CO)O)O)O)O)O |
SMILES (Isomeric) | CC(=O)C1=C(C=C(C=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
InChI | InChI=1S/C14H18O9/c1-5(16)10-7(18)2-6(17)3-8(10)22-14-13(21)12(20)11(19)9(4-15)23-14/h2-3,9,11-15,17-21H,4H2,1H3/t9-,11-,12+,13-,14-/m1/s1 |
InChI Key | GFKQVLKFPJGJEP-RGCYKPLRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H18O9 |
Molecular Weight | 330.29 g/mol |
Exact Mass | 330.09508215 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | -1.00 |
26089-54-3 |
1-[2,4-dihydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone |
Ethanone, 1-[2-(beta-D-glucopyranosyloxy)-4,6-dihydroxyphenyl]- |
DTXSID50948963 |
HY-N8738 |
AKOS040762080 |
2-Acetyl-3,5-dihydroxyphenyl hexopyranoside |
CS-0148991 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.03% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.41% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.35% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.70% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.69% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.61% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.18% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.70% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.46% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.48% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Curcuma comosa |
Leontodon tuberosus |
Myrcia multiflora |
PubChem | 179470 |
LOTUS | LTS0060239 |
wikiData | Q82926788 |