Mycemycin E
| Internal ID | f3fb70d9-e02a-4510-8270-9cc9ba49984a |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
| IUPAC Name | 2,8-dichloro-1-methyl-6-oxo-5H-benzo[b][1,4]benzoxazepine-4-carboxamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H10Cl2N2O3/c1-6-10(17)5-9(14(18)20)12-13(6)22-11-3-2-7(16)4-8(11)15(21)19-12/h2-5H,1H3,(H2,18,20)(H,19,21) |
| InChI Key | LKTXNDBBKSMZRJ-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.0068476 g/mol |
| Topological Polar Surface Area (TPSA) | 81.40 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.20% | 94.45% |
| CHEMBL240 | Q12809 | HERG | 93.89% | 89.76% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.79% | 96.95% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.46% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.45% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.39% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.28% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.10% | 94.73% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.71% | 92.29% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.47% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 87.95% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.75% | 97.21% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.95% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.19% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.17% | 91.19% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.74% | 86.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.33% | 90.24% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.87% | 81.11% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.54% | 94.42% |
| CHEMBL2346486 | P40261 | Nicotinamide N-methyltransferase | 81.19% | 83.04% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.57% | 95.48% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.25% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585143 |
| LOTUS | LTS0069432 |
| wikiData | Q77384742 |