Mussaendoside P
Internal ID | c4bcd05f-ce66-4ed2-a59c-757dd2af55af |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | (2E,4E,6R)-6-[(1S,3S,5R,6R,8R,11S,12S,15R,16R)-6-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-N-[(3S,4R,5R)-4,5-dimethyl-2-oxooxolan-3-yl]-2-methylhepta-2,4-dienamide |
SMILES (Canonical) | CC1C(OC(=O)C1NC(=O)C(=CC=CC(C)C2CCC3(C2(CCC45C3CCC6C4(C5)CC(C(C6(C)C)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(C(O1)C)O)O)O)O)C)C)C)C |
SMILES (Isomeric) | C[C@H]1[C@H](OC(=O)[C@H]1NC(=O)/C(=C/C=C/[C@@H](C)[C@H]2CC[C@@]3([C@@]2(CC[C@]45[C@H]3CC[C@@H]6[C@]4(C5)C[C@H]([C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)O)C)C)/C)C |
InChI | InChI=1S/C60H95NO23/c1-24(12-11-13-25(2)50(74)61-36-26(3)27(4)76-51(36)75)30-16-17-58(10)35-15-14-34-56(7,8)49(31(64)20-60(34)23-59(35,60)19-18-57(30,58)9)84-55-48(45(73)46(33(22-63)80-55)81-52-43(71)40(68)37(65)28(5)77-52)83-54-47(42(70)39(67)32(21-62)79-54)82-53-44(72)41(69)38(66)29(6)78-53/h11-13,24,26-49,52-55,62-73H,14-23H2,1-10H3,(H,61,74)/b12-11+,25-13+/t24-,26+,27-,28+,29+,30-,31-,32-,33-,34+,35+,36+,37+,38+,39-,40-,41-,42+,43-,44-,45+,46-,47-,48-,49+,52+,53+,54+,55+,57-,58+,59+,60-/m1/s1 |
InChI Key | VXWZPOBCAUZTDY-PHBRQRNESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C60H95NO23 |
Molecular Weight | 1198.40 g/mol |
Exact Mass | 1197.62948828 g/mol |
Topological Polar Surface Area (TPSA) | 372.00 Ų |
XlogP | 1.90 |
Atomic LogP (AlogP) | -0.69 |
H-Bond Acceptor | 23 |
H-Bond Donor | 13 |
Rotatable Bonds | 15 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.5833 | 58.33% |
Caco-2 | - | 0.8644 | 86.44% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.8000 | 80.00% |
Subcellular localzation | Mitochondria | 0.6433 | 64.33% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8006 | 80.06% |
OATP1B3 inhibitior | + | 0.9300 | 93.00% |
MATE1 inhibitior | - | 0.9646 | 96.46% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | + | 0.9241 | 92.41% |
P-glycoprotein inhibitior | + | 0.7452 | 74.52% |
P-glycoprotein substrate | + | 0.7095 | 70.95% |
CYP3A4 substrate | + | 0.7409 | 74.09% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8822 | 88.22% |
CYP3A4 inhibition | - | 0.8748 | 87.48% |
CYP2C9 inhibition | - | 0.8205 | 82.05% |
CYP2C19 inhibition | - | 0.8481 | 84.81% |
CYP2D6 inhibition | - | 0.9332 | 93.32% |
CYP1A2 inhibition | - | 0.8796 | 87.96% |
CYP2C8 inhibition | + | 0.7129 | 71.29% |
CYP inhibitory promiscuity | - | 0.7635 | 76.35% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9400 | 94.00% |
Carcinogenicity (trinary) | Non-required | 0.5202 | 52.02% |
Eye corrosion | - | 0.9858 | 98.58% |
Eye irritation | - | 0.8982 | 89.82% |
Skin irritation | - | 0.7164 | 71.64% |
Skin corrosion | - | 0.9238 | 92.38% |
Ames mutagenesis | - | 0.6700 | 67.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7891 | 78.91% |
Micronuclear | + | 0.7100 | 71.00% |
Hepatotoxicity | - | 0.7709 | 77.09% |
skin sensitisation | - | 0.8462 | 84.62% |
Respiratory toxicity | + | 0.7444 | 74.44% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.8500 | 85.00% |
Nephrotoxicity | - | 0.5662 | 56.62% |
Acute Oral Toxicity (c) | III | 0.6233 | 62.33% |
Estrogen receptor binding | + | 0.7447 | 74.47% |
Androgen receptor binding | + | 0.7532 | 75.32% |
Thyroid receptor binding | + | 0.6314 | 63.14% |
Glucocorticoid receptor binding | + | 0.7933 | 79.33% |
Aromatase binding | + | 0.7091 | 70.91% |
PPAR gamma | + | 0.8186 | 81.86% |
Honey bee toxicity | - | 0.5945 | 59.45% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
Fish aquatic toxicity | + | 0.9411 | 94.11% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.69% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.33% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.40% | 96.21% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.48% | 95.58% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.86% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.87% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.82% | 91.24% |
CHEMBL2581 | P07339 | Cathepsin D | 92.14% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.75% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.86% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.63% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.52% | 91.07% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.28% | 96.38% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.66% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.07% | 97.09% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.55% | 98.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.06% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.97% | 89.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.73% | 87.67% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.44% | 93.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.24% | 95.71% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.19% | 91.03% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.99% | 95.83% |
CHEMBL236 | P41143 | Delta opioid receptor | 84.62% | 99.35% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.48% | 97.14% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.18% | 92.88% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.13% | 95.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.76% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.69% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.52% | 97.36% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.67% | 89.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.34% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.09% | 91.19% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.73% | 89.34% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.09% | 95.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.61% | 95.50% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.49% | 80.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.37% | 92.78% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.34% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mussaenda pubescens |
PubChem | 101682154 |
LOTUS | LTS0268868 |
wikiData | Q105298806 |