Mururin C
Internal ID | 03eccb81-0bf4-4145-816d-c1857532562c |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-5-(3-hydroxypropyl)-7-methoxy-1-benzofuran-3-carbaldehyde |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(=C2C=O)C3=CC(=C(C(=C3)OC)O)O)CCCO |
SMILES (Isomeric) | COC1=CC(=CC2=C1OC(=C2C=O)C3=CC(=C(C(=C3)OC)O)O)CCCO |
InChI | InChI=1S/C20H20O7/c1-25-16-9-12(8-15(23)18(16)24)19-14(10-22)13-6-11(4-3-5-21)7-17(26-2)20(13)27-19/h6-10,21,23-24H,3-5H2,1-2H3 |
InChI Key | FJJBSMAMHGBNBY-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H20O7 |
Molecular Weight | 372.40 g/mol |
Exact Mass | 372.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 2.60 |
2-(3,4-dihydroxy-5-methoxyphenyl)-5-(3-hydroxypropyl)-7-methoxy-1-benzofuran-3-carbaldehyde |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 99.68% | 98.11% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.23% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.15% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.42% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.22% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.82% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.24% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.83% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.52% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.52% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.29% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.61% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 85.09% | 90.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.78% | 95.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.45% | 92.94% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.37% | 90.20% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.69% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.31% | 92.62% |
CHEMBL2424 | Q04760 | Glyoxalase I | 81.43% | 91.67% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.63% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brosimum acutifolium |
PubChem | 9999345 |
LOTUS | LTS0091201 |
wikiData | Q104996087 |