Multicolosic acid
| Internal ID | 328179b5-5f19-4fea-a11f-e52be128d0b8 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | 5-[(5E)-5-(carboxymethylidene)-4-hydroxy-2-oxofuran-3-yl]pentanoic acid |
| SMILES (Canonical) | C(CCC(=O)O)CC1=C(C(=CC(=O)O)OC1=O)O |
| SMILES (Isomeric) | C(CCC(=O)O)CC1=C(/C(=C\C(=O)O)/OC1=O)O |
| InChI | InChI=1S/C11H12O7/c12-8(13)4-2-1-3-6-10(16)7(5-9(14)15)18-11(6)17/h5,16H,1-4H2,(H,12,13)(H,14,15)/b7-5+ |
| InChI Key | MGCQOGPQJCIIGF-FNORWQNLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.05830272 g/mol |
| Topological Polar Surface Area (TPSA) | 121.00 Ų |
| XlogP | 0.10 |
| 4VG7LRS90Z |
| UNII-4VG7LRS90Z |
| (5E)-5-(Carboxymethylene)-2,5-dihydro-4-hydroxy-2-oxo-3-furanpentanoic acid |
| 3-Furanpentanoic acid, 5-(carboxymethylene)-2,5-dihydro-4-hydroxy-2-oxo-, (5E)- |
| 54854-94-3 |
| Q27896608 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.25% | 91.11% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 92.78% | 83.57% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.42% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.25% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.45% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.51% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.78% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122201306 |
| LOTUS | LTS0104882 |
| wikiData | Q27896608 |