Mukolidine
Internal ID | 45e94ef7-be36-4c7d-a87c-4bd5933b9e32 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 8-methoxy-9H-carbazole-3-carbaldehyde |
SMILES (Canonical) | COC1=CC=CC2=C1NC3=C2C=C(C=C3)C=O |
SMILES (Isomeric) | COC1=CC=CC2=C1NC3=C2C=C(C=C3)C=O |
InChI | InChI=1S/C14H11NO2/c1-17-13-4-2-3-10-11-7-9(8-16)5-6-12(11)15-14(10)13/h2-8,15H,1H3 |
InChI Key | KSTPFEFAPRYLOZ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C14H11NO2 |
Molecular Weight | 225.24 g/mol |
Exact Mass | 225.078978594 g/mol |
Topological Polar Surface Area (TPSA) | 42.10 Ų |
XlogP | 2.80 |
3-formyl-8-methoxycarbazole |
8-methoxy-9H-carbazole-3-carbaldehyde |
6-Formyl-1-methoxycarbazole |
CHEBI:178583 |
KSTPFEFAPRYLOZ-UHFFFAOYSA-N |
DTXSID001280691 |
8-Methoxy-9H-carbazole-3-carboxaldehyde |
87264-45-7 |
8-Methoxy-9H-carbazole-3-carboxaldehyde, 9CI |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.60% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.92% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.82% | 91.71% |
CHEMBL2535 | P11166 | Glucose transporter | 90.95% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.79% | 90.20% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.68% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.65% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.39% | 94.45% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.54% | 98.11% |
CHEMBL2581 | P07339 | Cathepsin D | 86.70% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.23% | 91.49% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.96% | 93.31% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.28% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.05% | 94.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.51% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya koenigii |
Wyethia helenioides |
PubChem | 53465568 |
LOTUS | LTS0137993 |
wikiData | Q105189199 |