Mukoenine B
Internal ID | 0f62e6ad-3b08-4366-94c4-507eafc863a3 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-9H-carbazole-3-carbaldehyde |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C(=CC2=C1NC3=CC=CC=C32)C=O)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C\CC1=C(C(=CC2=C1NC3=CC=CC=C32)C=O)O)/C)C |
InChI | InChI=1S/C23H25NO2/c1-15(2)7-6-8-16(3)11-12-19-22-20(13-17(14-25)23(19)26)18-9-4-5-10-21(18)24-22/h4-5,7,9-11,13-14,24,26H,6,8,12H2,1-3H3/b16-11- |
InChI Key | HYKYGURKMDNXGG-WJDWOHSUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H25NO2 |
Molecular Weight | 347.40 g/mol |
Exact Mass | 347.188529040 g/mol |
Topological Polar Surface Area (TPSA) | 53.10 Ų |
XlogP | 6.80 |
Mukoenine B |
3-Formyl-1-geranyl-2-hydroxycarbazole |
1-(3,7-Dimethyl-2,6-octadienyl)-2-hydroxy-9H-carbazole-3-carboxaldehyde, 9CI |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.84% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.29% | 98.95% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.73% | 98.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.12% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.53% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.14% | 94.73% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.55% | 92.08% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 90.91% | 98.59% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.10% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.02% | 89.00% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 84.99% | 97.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.66% | 91.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.81% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.67% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.49% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.46% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.18% | 94.62% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 80.45% | 95.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.15% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya koenigii |
PubChem | 131752937 |
LOTUS | LTS0134915 |
wikiData | Q105035362 |