Motualevic acid A
| Internal ID | 10cdee02-28fc-4dc5-9ae4-d9fba032f2ae |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids |
| IUPAC Name | 2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]acetic acid |
| SMILES (Canonical) | C(CCCCC=CC(=O)NCC(=O)O)CCCCC=C(Br)Br |
| SMILES (Isomeric) | C(CCCC/C=C/C(=O)NCC(=O)O)CCCCC=C(Br)Br |
| InChI | InChI=1S/C16H25Br2NO3/c17-14(18)11-9-7-5-3-1-2-4-6-8-10-12-15(20)19-13-16(21)22/h10-12H,1-9,13H2,(H,19,20)(H,21,22)/b12-10+ |
| InChI Key | ZLIHRGDEFDFVOK-ZRDIBKRKSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H25Br2NO3 |
| Molecular Weight | 439.20 g/mol |
| Exact Mass | 439.01807 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 6.00 |
| CHEBI:66405 |
| N-[(2E)-14,14-dibromotetradeca-2,13-dienoyl]glycine |
| CHEMBL1171537 |
| Q27134962 |
| 2-[[(2E)-14,14-dibromotetradeca-2,13-dienoyl]amino]acetic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.25% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.38% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.62% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.31% | 91.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.31% | 89.34% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.61% | 96.09% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.61% | 94.33% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.54% | 97.00% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 81.52% | 90.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.04% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.30% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.16% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25242622 |
| LOTUS | LTS0129653 |
| wikiData | Q27134962 |