Moniliformin
| Internal ID | f4f52de8-4fea-4924-bd0e-4d5fff0fe29f |
| Taxonomy | Organic acids and derivatives > Vinylogous acids |
| IUPAC Name | 3-hydroxycyclobut-3-ene-1,2-dione |
| SMILES (Canonical) | C1=C(C(=O)C1=O)O |
| SMILES (Isomeric) | C1=C(C(=O)C1=O)O |
| InChI | InChI=1S/C4H2O3/c5-2-1-3(6)4(2)7/h1,5H |
| InChI Key | KGPQKNJSZNXOPV-UHFFFAOYSA-N |
| Popularity | 244 references in papers |
| Molecular Formula | C4H2O3 |
| Molecular Weight | 98.06 g/mol |
| Exact Mass | 98.000393922 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | -0.60 |
| 31876-38-7 |
| 3-hydroxycyclobut-3-ene-1,2-dione |
| 3-Cyclobutene-1,2-dione, 3-hydroxy- |
| 1-Hydroxycyclobut-1-ene-3,4-dione |
| 3-Hydroxy-3-cyclobutene-1,2-dione |
| 1-hydroxycyclobutene-3,4-dione |
| G5JMQ8SDF8 |
| 1345994-72-0 |
| Semisquaric acid |
| NSC292896 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.17% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.44% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.32% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.95% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.02% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sciadopitys verticillata |
| PubChem | 40452 |
| LOTUS | LTS0054574 |
| wikiData | Q105188994 |