Momordicoside L
Internal ID | ea70da89-49a9-4f68-904e-5e5e851e13b1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-17-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-4,4,13,14-tetramethyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde |
SMILES (Canonical) | CC(CC=CC(C)(C)O)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)OC5C(C(C(C(O5)CO)O)O)O)C=O)C)C |
SMILES (Isomeric) | C[C@H](C/C=C/C(C)(C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C=O)C)C |
InChI | InChI=1S/C36H58O9/c1-20(9-8-13-32(2,3)43)21-12-14-35(7)30-24(44-31-29(42)28(41)27(40)25(18-37)45-31)17-23-22(10-11-26(39)33(23,4)5)36(30,19-38)16-15-34(21,35)6/h8,13,17,19-22,24-31,37,39-43H,9-12,14-16,18H2,1-7H3/b13-8+/t20-,21-,22-,24+,25-,26+,27-,28+,29-,30+,31-,34-,35+,36-/m1/s1 |
InChI Key | BOHOBTRHAFBJOW-MLFDEFIASA-N |
Popularity | 4 references in papers |
Molecular Formula | C36H58O9 |
Molecular Weight | 634.80 g/mol |
Exact Mass | 634.40808342 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | 3.10 |
81348-83-6 |
(3S,7S,8S,9R,10R,13R,14S,17R)-3-hydroxy-17-[(E,2R)-6-hydroxy-6-methylhept-4-en-2-yl]-4,4,13,14-tetramethyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-9-carbaldehyde |
CHEBI:176265 |
DTXSID201316961 |
AKOS040760568 |
FS-7654 |
HY-122919 |
CS-0090439 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.83% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.49% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.67% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.29% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 89.27% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.91% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.85% | 96.61% |
CHEMBL1977 | P11473 | Vitamin D receptor | 87.73% | 99.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.86% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.39% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.93% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.40% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.50% | 94.73% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.28% | 93.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.20% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.82% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.60% | 97.50% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.72% | 92.86% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.77% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 101743788 |
LOTUS | LTS0206587 |
wikiData | Q104939231 |