Momordicinin
Internal ID | 9cd799c6-715d-4f9d-b0dd-653476cb2d1d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,5,9,9,13,19,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-one |
SMILES (Canonical) | CC1CCC23CCC4(C5(CCC6C(C(=O)CCC6(C5C=CC4(C2C1C)OC3)C)(C)C)C)C |
SMILES (Isomeric) | CC1CCC23CCC4(C5(CCC6C(C(=O)CCC6(C5C=CC4(C2C1C)OC3)C)(C)C)C)C |
InChI | InChI=1S/C30H46O2/c1-19-8-14-29-17-16-28(7)27(6)13-9-21-25(3,4)23(31)11-12-26(21,5)22(27)10-15-30(28,32-18-29)24(29)20(19)2/h10,15,19-22,24H,8-9,11-14,16-18H2,1-7H3 |
InChI Key | PKMBOLUTQNQQBP-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H46O2 |
Molecular Weight | 438.70 g/mol |
Exact Mass | 438.349780706 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 7.10 |
SCHEMBL21264287 |
CHEBI:190390 |
BDBM604155 |
13b,28-Epoxy-11-ursen-3-one |
US11660306, Example Momordicinin |
4,5,9,9,13,19,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.95% | 91.11% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 94.75% | 85.30% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.27% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.25% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.07% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.91% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.85% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.84% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.50% | 96.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.74% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.33% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.90% | 94.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.69% | 94.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.44% | 97.25% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.32% | 96.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.04% | 95.38% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.01% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 14526924 |
LOTUS | LTS0053752 |
wikiData | Q105210492 |