Mogrol
Internal ID | cd013eb0-fbcd-4509-9160-2d293bd0d61e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (3S,8S,9R,10R,11R,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1CCC2(C1(CC(C3(C2CC=C4C3CCC(C4(C)C)O)C)O)C)C |
SMILES (Isomeric) | C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1CC[C@@]2([C@@]1(C[C@H]([C@@]3([C@H]2CC=C4[C@H]3CC[C@@H](C4(C)C)O)C)O)C)C |
InChI | InChI=1S/C30H52O4/c1-18(9-13-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-14-23(31)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-25,31-34H,9,11-17H2,1-8H3/t18-,19-,21-,22+,23+,24-,25-,28+,29-,30+/m1/s1 |
InChI Key | JLYBBRAAICDTIS-AYEHCKLZSA-N |
Popularity | 6 references in papers |
Molecular Formula | C30H52O4 |
Molecular Weight | 476.70 g/mol |
Exact Mass | 476.38656014 g/mol |
Topological Polar Surface Area (TPSA) | 80.90 Ų |
XlogP | 5.40 |
88930-15-8 |
(10alpha,24R)-9beta-Methyl-19-norlanosta-5-ene-3beta,11alpha,24,25-tetrol |
(3S,8S,9R,10R,11R,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
CHEMBL1829226 |
SCHEMBL12857257 |
CHEBI:138974 |
JLYBBRAAICDTIS-AYEHCKLZSA-N |
HY-N2312 |
BDBM50537682 |
AKOS030631735 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.20% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.85% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.81% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.10% | 96.61% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.16% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.93% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.93% | 93.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.44% | 94.45% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.93% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.31% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 83.94% | 93.31% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.91% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.54% | 82.69% |
CHEMBL1977 | P11473 | Vitamin D receptor | 82.29% | 99.43% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.11% | 96.43% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.91% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.38% | 98.05% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.38% | 95.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.33% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.82% | 95.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.73% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.56% | 97.79% |
CHEMBL5028 | O14672 | ADAM10 | 80.48% | 97.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.48% | 97.29% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.16% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Siraitia grosvenorii |
PubChem | 14525327 |
LOTUS | LTS0045719 |
wikiData | Q74417578 |