Mirabamide G
| Internal ID | cd58cd18-19be-4e3b-b66b-755d7c07a3d1 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R,3S,4S)-4-[[(2S,3S)-3-amino-2-[[(Z)-2-[[2-[[(4Z,6E)-2,3-dihydroxy-2,6,8-trimethyldeca-4,6-dienoyl]amino]acetyl]amino]but-2-enoyl]amino]butanoyl]amino]-N'-[(3R,6S,9S,15R,18R,19R,22S,24S)-24-chloro-6-[(1R)-1-hydroxyethyl]-3-[(R)-(4-hydroxyphenyl)-methoxymethyl]-15-(methoxymethyl)-7,9-dimethyl-2,5,8,11,14,17,21-heptaoxo-19-propan-2-yl-20-oxa-1,4,7,10,13,16-hexazabicyclo[20.4.0]hexacosan-18-yl]-2,3-dimethylpentanediamide |
| SMILES (Canonical) | CCC(C)C=C(C)C=CC(C(C)(C(=O)NCC(=O)NC(=CC)C(=O)NC(C(C)N)C(=O)NC(C(C)C(C)C(=O)N)C(=O)NC1C(OC(=O)C2CC(CCN2C(=O)C(NC(=O)C(N(C(=O)C(NC(=O)CNC(=O)C(NC1=O)COC)C)C)C(C)O)C(C3=CC=C(C=C3)O)OC)Cl)C(C)C)O)O |
| SMILES (Isomeric) | CCC(C)/C=C(\C)/C=C\C(C(C)(C(=O)NCC(=O)N/C(=C\C)/C(=O)N[C@@H]([C@H](C)N)C(=O)N[C@@H]([C@@H](C)[C@@H](C)C(=O)N)C(=O)N[C@@H]1[C@H](OC(=O)[C@@H]2C[C@H](CCN2C(=O)[C@H](NC(=O)[C@@H](N(C(=O)[C@@H](NC(=O)CNC(=O)[C@H](NC1=O)COC)C)C)[C@@H](C)O)[C@@H](C3=CC=C(C=C3)O)OC)Cl)C(C)C)O)O |
| InChI | InChI=1S/C66H102ClN13O20/c1-16-32(5)26-33(6)18-23-45(83)66(12,97)65(96)71-29-47(85)73-42(17-2)57(88)76-49(36(9)68)59(90)75-48(34(7)35(8)55(69)86)58(89)77-50-53(31(3)4)100-64(95)44-27-40(67)24-25-80(44)63(94)51(54(99-15)39-19-21-41(82)22-20-39)78-61(92)52(38(11)81)79(13)62(93)37(10)72-46(84)28-70-56(87)43(30-98-14)74-60(50)91/h17-23,26,31-32,34-38,40,43-45,48-54,81-83,97H,16,24-25,27-30,68H2,1-15H3,(H2,69,86)(H,70,87)(H,71,96)(H,72,84)(H,73,85)(H,74,91)(H,75,90)(H,76,88)(H,77,89)(H,78,92)/b23-18-,33-26+,42-17-/t32?,34-,35+,36-,37-,38+,40-,43+,44-,45?,48-,49-,50+,51+,52-,53+,54+,66?/m0/s1 |
| InChI Key | CHRQWEAARHYJPF-NAQDZKCESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C66H102ClN13O20 |
| Molecular Weight | 1433.00 g/mol |
| Exact Mass | 1431.7052604 g/mol |
| Topological Polar Surface Area (TPSA) | 497.00 Ų |
| XlogP | 0.40 |
| Atomic LogP (AlogP) | -2.94 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 15 |
| Rotatable Bonds | 26 |
| CHEBI:68405 |
| CHEMBL1689428 |
| Q27136904 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7444 | 74.44% |
| Caco-2 | - | 0.8620 | 86.20% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Lysosomes | 0.5642 | 56.42% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7967 | 79.67% |
| OATP1B3 inhibitior | + | 0.9286 | 92.86% |
| MATE1 inhibitior | - | 0.8446 | 84.46% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9769 | 97.69% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8787 | 87.87% |
| CYP3A4 substrate | + | 0.7601 | 76.01% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8506 | 85.06% |
| CYP3A4 inhibition | - | 0.8271 | 82.71% |
| CYP2C9 inhibition | - | 0.7764 | 77.64% |
| CYP2C19 inhibition | - | 0.7834 | 78.34% |
| CYP2D6 inhibition | - | 0.8245 | 82.45% |
| CYP1A2 inhibition | - | 0.8312 | 83.12% |
| CYP2C8 inhibition | + | 0.8633 | 86.33% |
| CYP inhibitory promiscuity | - | 0.9505 | 95.05% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8100 | 81.00% |
| Carcinogenicity (trinary) | Non-required | 0.4782 | 47.82% |
| Eye corrosion | - | 0.9821 | 98.21% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7501 | 75.01% |
| Skin corrosion | - | 0.9153 | 91.53% |
| Ames mutagenesis | - | 0.7000 | 70.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7167 | 71.67% |
| Micronuclear | + | 0.9000 | 90.00% |
| Hepatotoxicity | + | 0.5287 | 52.87% |
| skin sensitisation | - | 0.8428 | 84.28% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.9889 | 98.89% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | + | 0.6010 | 60.10% |
| Acute Oral Toxicity (c) | III | 0.6145 | 61.45% |
| Estrogen receptor binding | + | 0.5310 | 53.10% |
| Androgen receptor binding | + | 0.7591 | 75.91% |
| Thyroid receptor binding | + | 0.7643 | 76.43% |
| Glucocorticoid receptor binding | + | 0.8151 | 81.51% |
| Aromatase binding | + | 0.7787 | 77.87% |
| PPAR gamma | + | 0.8022 | 80.22% |
| Honey bee toxicity | - | 0.6156 | 61.56% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.9200 | 92.00% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.38% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.27% | 96.09% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 98.16% | 83.14% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.98% | 85.14% |
| CHEMBL236 | P41143 | Delta opioid receptor | 97.65% | 99.35% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 96.78% | 98.59% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.47% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.18% | 97.25% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 95.99% | 90.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.74% | 89.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.26% | 90.08% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.69% | 95.93% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 93.31% | 91.03% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 93.20% | 97.31% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 93.01% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.79% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.66% | 97.14% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 91.70% | 89.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.82% | 95.89% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 89.78% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.05% | 95.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.00% | 96.90% |
| CHEMBL3837 | P07711 | Cathepsin L | 88.74% | 96.61% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.73% | 98.05% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.56% | 82.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.87% | 97.79% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.80% | 99.23% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.36% | 92.29% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 86.24% | 80.71% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 86.19% | 94.36% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.13% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 86.07% | 96.25% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 85.43% | 81.58% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.29% | 89.62% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.96% | 94.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.96% | 90.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 82.53% | 92.50% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.45% | 85.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.16% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.67% | 93.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.57% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.91% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.57% | 91.07% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.54% | 96.11% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 80.30% | 98.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 51041988 |
| LOTUS | LTS0163259 |
| wikiData | Q27136904 |