Minutissamide D
| Internal ID | f7d87114-70bc-444e-8a63-573ede01601a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[(3S,6S,9R,12S,15E,18S,21E,24S,27R,28R,31S)-3,18-bis(2-amino-2-oxoethyl)-15,21-di(ethylidene)-27-hydroxy-6-[(1R)-1-hydroxyethyl]-28-[(2S)-12-hydroxytetradecan-2-yl]-4,9-dimethyl-2,5,8,11,14,17,20,23,26,30-decaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29-decazabicyclo[29.3.0]tetratriacontan-12-yl]acetamide |
| SMILES (Canonical) | CCC(CCCCCCCCCC(C)C1C(C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(=CC)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N1)CC(=O)N)C)C(C)O)C)CC(=O)N)CC(=O)N)C(C)C)O)O |
| SMILES (Isomeric) | CCC(CCCCCCCCC[C@H](C)[C@@H]1[C@H](C(=O)N[C@H](C(=O)N/C(=C/C)/C(=O)N[C@H](C(=O)N/C(=C/C)/C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N2CCC[C@H]2C(=O)N1)CC(=O)N)C)[C@@H](C)O)C)CC(=O)N)CC(=O)N)C(C)C)O)O |
| InChI | InChI=1S/C55H91N13O16/c1-10-32(70)22-19-17-15-13-14-16-18-21-29(6)43-45(74)53(82)64-42(28(4)5)52(81)61-34(12-3)48(77)63-36(26-40(57)72)50(79)60-33(11-2)47(76)62-35(25-39(56)71)49(78)59-30(7)46(75)66-44(31(8)69)55(84)67(9)38(27-41(58)73)54(83)68-24-20-23-37(68)51(80)65-43/h11-12,28-32,35-38,42-45,69-70,74H,10,13-27H2,1-9H3,(H2,56,71)(H2,57,72)(H2,58,73)(H,59,78)(H,60,79)(H,61,81)(H,62,76)(H,63,77)(H,64,82)(H,65,80)(H,66,75)/b33-11+,34-12+/t29-,30+,31+,32?,35-,36-,37-,38-,42-,43+,44-,45+/m0/s1 |
| InChI Key | QBOXPOZQNMGPJN-MVNQSCNZSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C55H91N13O16 |
| Molecular Weight | 1190.40 g/mol |
| Exact Mass | 1189.67067387 g/mol |
| Topological Polar Surface Area (TPSA) | 463.00 Ų |
| XlogP | -0.40 |
| Atomic LogP (AlogP) | -3.27 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 20 |
| CHEBI:69904 |
| CHEMBL1814284 |
| DTXSID101047743 |
| Q27138248 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6729 | 67.29% |
| Caco-2 | - | 0.8629 | 86.29% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.5864 | 58.64% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8263 | 82.63% |
| OATP1B3 inhibitior | + | 0.8828 | 88.28% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8817 | 88.17% |
| BSEP inhibitior | + | 0.9165 | 91.65% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8819 | 88.19% |
| CYP3A4 substrate | + | 0.7210 | 72.10% |
| CYP2C9 substrate | - | 0.8019 | 80.19% |
| CYP2D6 substrate | - | 0.8681 | 86.81% |
| CYP3A4 inhibition | - | 0.9007 | 90.07% |
| CYP2C9 inhibition | - | 0.8760 | 87.60% |
| CYP2C19 inhibition | - | 0.8830 | 88.30% |
| CYP2D6 inhibition | - | 0.9347 | 93.47% |
| CYP1A2 inhibition | - | 0.8718 | 87.18% |
| CYP2C8 inhibition | + | 0.6548 | 65.48% |
| CYP inhibitory promiscuity | - | 0.9912 | 99.12% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.5515 | 55.15% |
| Eye corrosion | - | 0.9855 | 98.55% |
| Eye irritation | - | 0.8970 | 89.70% |
| Skin irritation | - | 0.7609 | 76.09% |
| Skin corrosion | - | 0.8998 | 89.98% |
| Ames mutagenesis | - | 0.6837 | 68.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6556 | 65.56% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | + | 0.5250 | 52.50% |
| skin sensitisation | - | 0.8639 | 86.39% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.6968 | 69.68% |
| Acute Oral Toxicity (c) | III | 0.6591 | 65.91% |
| Estrogen receptor binding | + | 0.7229 | 72.29% |
| Androgen receptor binding | + | 0.7229 | 72.29% |
| Thyroid receptor binding | + | 0.5214 | 52.14% |
| Glucocorticoid receptor binding | + | 0.6489 | 64.89% |
| Aromatase binding | + | 0.7329 | 73.29% |
| PPAR gamma | + | 0.7773 | 77.73% |
| Honey bee toxicity | - | 0.7607 | 76.07% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5738 | 57.38% |
| Fish aquatic toxicity | + | 0.7030 | 70.30% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.57% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.54% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.33% | 94.75% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.32% | 96.31% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 97.12% | 95.92% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.08% | 90.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.98% | 96.47% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.83% | 94.66% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.80% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.47% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.34% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.94% | 93.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.75% | 82.38% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 93.51% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.24% | 90.17% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 92.18% | 95.27% |
| CHEMBL3837 | P07711 | Cathepsin L | 92.07% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.93% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.45% | 97.09% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 91.23% | 94.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.14% | 95.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.30% | 97.05% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.86% | 97.47% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.39% | 92.86% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.18% | 95.71% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.14% | 95.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.82% | 100.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.70% | 94.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.44% | 91.11% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.52% | 91.03% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.35% | 85.14% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.29% | 95.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.84% | 93.03% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.45% | 98.57% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 86.39% | 99.29% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 86.03% | 92.12% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.54% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.28% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.03% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.99% | 94.45% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.93% | 99.18% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.87% | 95.93% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.53% | 92.95% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 83.00% | 92.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.90% | 100.00% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 82.89% | 92.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.74% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.39% | 96.03% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.33% | 92.88% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.08% | 97.50% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 81.71% | 95.69% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.71% | 98.05% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.54% | 99.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.47% | 98.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.24% | 89.34% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.23% | 89.50% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.16% | 90.24% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.90% | 97.29% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.57% | 88.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.20% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53467423 |
| LOTUS | LTS0170527 |
| wikiData | Q27138248 |