Minioluteumide E
| Internal ID | 9b152d3c-8e06-45fc-9d95-48e610378070 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | [(4R,5aS,9S,9aS)-9-hydroxy-6,6,9a-trimethyl-3-oxo-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-4-yl] (2S)-2-acetamido-3-methylbutanoate |
| SMILES (Canonical) | CC(C)C(C(=O)OC1CC2C(CCC(C2(C3=C1C(=O)OC3)C)O)(C)C)NC(=O)C |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)O[C@@H]1C[C@@H]2[C@]([C@H](CCC2(C)C)O)(C3=C1C(=O)OC3)C)NC(=O)C |
| InChI | InChI=1S/C22H33NO6/c1-11(2)18(23-12(3)24)20(27)29-14-9-15-21(4,5)8-7-16(25)22(15,6)13-10-28-19(26)17(13)14/h11,14-16,18,25H,7-10H2,1-6H3,(H,23,24)/t14-,15+,16+,18+,22-/m1/s1 |
| InChI Key | HBMYEJCMSBLMPA-GZOXUXNESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.23078777 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.72% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.80% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.36% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.26% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.14% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.08% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.28% | 96.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.23% | 91.19% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.88% | 94.66% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.01% | 83.82% |
| CHEMBL5028 | O14672 | ADAM10 | 87.55% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.28% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.94% | 97.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.90% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.38% | 97.79% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.11% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.27% | 96.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.21% | 82.69% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.82% | 93.04% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.71% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.37% | 89.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.76% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.77% | 93.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.23% | 93.03% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.84% | 91.07% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.64% | 94.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.64% | 95.38% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.44% | 91.24% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.24% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583358 |
| LOTUS | LTS0101104 |
| wikiData | Q75059575 |