Minalemine A
| Internal ID | 81730fd4-27c4-4c93-9fe4-0c0941ed8ee9 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | 3-[[2-[[(2S)-1-[4-(diaminomethylideneamino)butylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-N-[5-(diaminomethylideneamino)pentyl]decanamide |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NCCCCCN=C(N)N)NCC(=O)NC(CC(C)C)C(=O)NCCCCN=C(N)N |
| SMILES (Isomeric) | CCCCCCCC(CC(=O)NCCCCCN=C(N)N)NCC(=O)N[C@@H](CC(C)C)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C29H60N10O3/c1-4-5-6-7-9-14-23(20-25(40)34-15-10-8-11-17-36-28(30)31)38-21-26(41)39-24(19-22(2)3)27(42)35-16-12-13-18-37-29(32)33/h22-24,38H,4-21H2,1-3H3,(H,34,40)(H,35,42)(H,39,41)(H4,30,31,36)(H4,32,33,37)/t23?,24-/m0/s1 |
| InChI Key | UYMLCTRITFFGRD-CGAIIQECSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C29H60N10O3 |
| Molecular Weight | 596.90 g/mol |
| Exact Mass | 596.48498581 g/mol |
| Topological Polar Surface Area (TPSA) | 228.00 Ų |
| XlogP | 1.60 |
| Atomic LogP (AlogP) | 0.96 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 26 |
| 3-((2-(((2S)-1-(4-(diaminomethylideneamino)butylamino)-4-methyl-1-oxopentan-2-yl)amino)-2-oxoethyl)amino)-N-(5-(diaminomethylideneamino)pentyl)decanamide |
| 3-[[2-[[(2S)-1-[4-(diaminomethylideneamino)butylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-N-[5-(diaminomethylideneamino)pentyl]decanamide |
| RefChem:158939 |
| (2S)-N-((2S)-1-(4-(diaminomethylideneamino)butylamino)-4-methyl-1-oxopentan-2-yl)-2-((3-(5-(diaminomethylideneamino)pentylamino)-3-oxopropyl)amino)nonanamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9149 | 91.49% |
| Caco-2 | - | 0.8530 | 85.30% |
| Blood Brain Barrier | + | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Mitochondria | 0.5619 | 56.19% |
| OATP2B1 inhibitior | - | 0.5631 | 56.31% |
| OATP1B1 inhibitior | + | 0.8991 | 89.91% |
| OATP1B3 inhibitior | + | 0.9404 | 94.04% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.6798 | 67.98% |
| P-glycoprotein inhibitior | + | 0.7111 | 71.11% |
| P-glycoprotein substrate | + | 0.8701 | 87.01% |
| CYP3A4 substrate | + | 0.6189 | 61.89% |
| CYP2C9 substrate | - | 0.5973 | 59.73% |
| CYP2D6 substrate | - | 0.7521 | 75.21% |
| CYP3A4 inhibition | - | 0.9001 | 90.01% |
| CYP2C9 inhibition | - | 0.7629 | 76.29% |
| CYP2C19 inhibition | - | 0.7175 | 71.75% |
| CYP2D6 inhibition | - | 0.8009 | 80.09% |
| CYP1A2 inhibition | - | 0.8266 | 82.66% |
| CYP2C8 inhibition | - | 0.7448 | 74.48% |
| CYP inhibitory promiscuity | - | 0.9637 | 96.37% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6746 | 67.46% |
| Eye corrosion | - | 0.9676 | 96.76% |
| Eye irritation | - | 0.9013 | 90.13% |
| Skin irritation | - | 0.7781 | 77.81% |
| Skin corrosion | - | 0.9222 | 92.22% |
| Ames mutagenesis | - | 0.6578 | 65.78% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6140 | 61.40% |
| Micronuclear | + | 0.5100 | 51.00% |
| Hepatotoxicity | - | 0.6115 | 61.15% |
| skin sensitisation | - | 0.8471 | 84.71% |
| Respiratory toxicity | + | 0.6000 | 60.00% |
| Reproductive toxicity | - | 0.6111 | 61.11% |
| Mitochondrial toxicity | - | 0.5250 | 52.50% |
| Nephrotoxicity | + | 0.5998 | 59.98% |
| Acute Oral Toxicity (c) | III | 0.6920 | 69.20% |
| Estrogen receptor binding | + | 0.6575 | 65.75% |
| Androgen receptor binding | + | 0.6887 | 68.87% |
| Thyroid receptor binding | + | 0.5607 | 56.07% |
| Glucocorticoid receptor binding | + | 0.5762 | 57.62% |
| Aromatase binding | + | 0.5986 | 59.86% |
| PPAR gamma | + | 0.6185 | 61.85% |
| Honey bee toxicity | - | 0.9289 | 92.89% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | + | 0.7726 | 77.26% |
| Fish aquatic toxicity | - | 0.3752 | 37.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.88% | 89.63% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.53% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.18% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.98% | 99.17% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 96.87% | 90.24% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.20% | 97.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.03% | 91.11% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.74% | 91.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.26% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.11% | 93.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.70% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.39% | 97.21% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.10% | 90.71% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.69% | 92.08% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.57% | 97.23% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.43% | 100.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 92.39% | 96.67% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.29% | 92.86% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.15% | 92.29% |
| CHEMBL3837 | P07711 | Cathepsin L | 91.23% | 96.61% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.13% | 96.47% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 90.78% | 98.05% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 90.67% | 86.67% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 90.43% | 98.03% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.33% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.71% | 100.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.53% | 85.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.50% | 94.45% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.27% | 96.67% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 88.19% | 87.45% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 88.19% | 89.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.26% | 100.00% |
| CHEMBL240 | Q12809 | HERG | 86.18% | 89.76% |
| CHEMBL236 | P41143 | Delta opioid receptor | 86.04% | 99.35% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.33% | 83.10% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.34% | 95.71% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 84.33% | 97.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.94% | 96.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.63% | 91.19% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.55% | 93.04% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.49% | 90.20% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.44% | 89.34% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 83.42% | 96.28% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 82.59% | 96.73% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.45% | 89.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.33% | 96.90% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.95% | 98.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.21% | 100.00% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 80.63% | 98.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.54% | 94.73% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 80.50% | 98.94% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.10% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10675026 |
| LOTUS | LTS0132491 |
| wikiData | Q105281661 |