Mimosine methyl ester
| Internal ID | 95f2b0a6-05aa-475d-ab3a-ba82a32ef869 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acid esters |
| IUPAC Name | methyl (2S)-2-amino-3-(3-hydroxy-4-oxopyridin-1-yl)propanoate |
| SMILES (Canonical) | COC(=O)C(CN1C=CC(=O)C(=C1)O)N |
| SMILES (Isomeric) | COC(=O)[C@H](CN1C=CC(=O)C(=C1)O)N |
| InChI | InChI=1S/C9H12N2O4/c1-15-9(14)6(10)4-11-3-2-7(12)8(13)5-11/h2-3,5-6,13H,4,10H2,1H3/t6-/m0/s1 |
| InChI Key | IOYVGPITPVKNSC-LURJTMIESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07970687 g/mol |
| Topological Polar Surface Area (TPSA) | 92.90 Ų |
| XlogP | -0.90 |
| 60343-53-5 |
| methyl (S)-2-amino-3-(3-hydroxy-4-oxopyridin-1(4H)-yl)propanoate |
| 1(4H)-Pyridinepropanoicacid, a-amino-3-hydroxy-4-oxo-, methylester, (S)- (9CI) |
| L-Mimosine methyl ester |
| methyl (2S)-2-amino-3-(3-hydroxy-4-oxopyridin-1-yl)propanoate |
| starbld0023872 |
| DTXSID10209103 |
| AKOS040753057 |
| 1(4H)-Pyridinepropanoic acid, alpha-amino-3-hydroxy-4-oxo-, methyl ester, (S)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.61% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.93% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.22% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.96% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.95% | 90.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.65% | 97.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.40% | 95.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.46% | 94.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.41% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.13% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.12% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senegalia berlandieri |
| PubChem | 186729 |
| LOTUS | LTS0139598 |
| wikiData | Q83083265 |