Mimengoside E
Internal ID | abbe824b-1ba4-4f7b-9ad2-8cefb0eb6df0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4R,5R,6S)-6-[(2R,3R,4S,5S,6R)-2-[[(3S,4R,4aR,6aS,6bR,8S,8aS,12aS,14bS)-8-hydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a-dodecahydropicen-3-yl]oxy]-5-hydroxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(C(OC(C3OC4C(C(C(C(O4)CO)O)O)O)OC5CCC6(C(C5(C)CO)CCC7(C6=CC=C8C7(CC(C9(C8CC(CC9)(C)C)CO)O)C)C)C)C)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@H]3[C@H]([C@H](O[C@H]([C@@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5CC[C@]6([C@H]([C@]5(C)CO)CC[C@@]7(C6=CC=C8[C@]7(C[C@@H]([C@@]9([C@H]8CC(CC9)(C)C)CO)O)C)C)C)C)O)CO)O)O)O |
InChI | InChI=1S/C54H88O22/c1-23-33(60)36(63)39(66)45(69-23)74-42-28(20-56)72-47(41(68)38(42)65)75-43-34(61)24(2)70-48(44(43)76-46-40(67)37(64)35(62)27(19-55)71-46)73-32-12-13-50(5)29(51(32,6)21-57)11-14-52(7)30(50)10-9-25-26-17-49(3,4)15-16-54(26,22-58)31(59)18-53(25,52)8/h9-10,23-24,26-29,31-48,55-68H,11-22H2,1-8H3/t23-,24+,26-,27+,28+,29+,31-,32-,33-,34-,35+,36+,37-,38+,39+,40+,41+,42+,43-,44+,45-,46-,47-,48-,50-,51-,52+,53+,54+/m0/s1 |
InChI Key | NWQQCEBYZYQXIQ-MXADEGCQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C54H88O22 |
Molecular Weight | 1089.30 g/mol |
Exact Mass | 1088.57672443 g/mol |
Topological Polar Surface Area (TPSA) | 357.00 Ų |
XlogP | -0.50 |
CHEMBL501564 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.30% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.45% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.06% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.33% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.43% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.17% | 89.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.81% | 97.53% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.51% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.33% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.01% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.17% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.51% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.29% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.51% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.32% | 96.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.49% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja officinalis |
PubChem | 44566640 |
NPASS | NPC138057 |
ChEMBL | CHEMBL501564 |
LOTUS | LTS0229387 |
wikiData | Q105186764 |