Milletenin C
| Internal ID | 7111c2bb-9b86-4bb3-a388-de48e54e0d5b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6,7-dimethoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)C(=O)C=C(O2)C3=CC4=C(C=C3)OCO4)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)C(=O)C=C(O2)C3=CC4=C(C=C3)OCO4)OC |
| InChI | InChI=1S/C18H14O6/c1-20-16-6-11-12(19)7-14(24-15(11)8-17(16)21-2)10-3-4-13-18(5-10)23-9-22-13/h3-8H,9H2,1-2H3 |
| InChI Key | HCZZPIBXVSKNNL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 2.90 |
| 6,7-Dimethoxy-3',4'-methylenedioxyflavone |
| CHEBI:196321 |
| LMPK12110067 |
| 2-(1,3-benzodioxol-5-yl)-6,7-dimethoxychromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.37% | 96.77% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.15% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.82% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.91% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.78% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.39% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.18% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.71% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.55% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.54% | 85.30% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 87.86% | 80.96% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.04% | 92.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.45% | 93.31% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.23% | 82.67% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 83.30% | 85.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.45% | 94.80% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.72% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.18% | 96.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.09% | 94.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.08% | 98.75% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.82% | 92.38% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.80% | 95.53% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.66% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.31% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia erythrocalyx |
| PubChem | 14483216 |
| LOTUS | LTS0141547 |
| wikiData | Q105026220 |