Microviridin I
| Internal ID | 567d2660-0f6a-4456-8615-665c10352334 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2S)-2-[[(1S,4S,10S,13S,19S,22S,25S,29R,30S,33S,43S)-30-[[(2S,3R)-2-[[(2R)-1-[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-4-[(4-hydroxyphenyl)methyl]-22-(1H-indol-3-ylmethyl)-29-methyl-33-(2-methylpropyl)-2,5,11,16,21,24,27,31,34,41,45,47-dodecaoxo-15,28-dioxa-3,6,12,20,23,32,35,40,44,46-decazatetracyclo[17.16.10.213,25.06,10]heptatetracontane-43-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC2CCCCNC(=O)CC(NC(=O)C3CCC(=O)OCC(C(=O)NC(CC(=O)O1)C(=O)NC(C(=O)N3)CC4=CNC5=CC=CC=C54)NC(=O)C6CCCN6C(=O)C(NC2=O)CC7=CC=C(C=C7)O)C(=O)NC(CC8=CC=C(C=C8)O)C(=O)O)CC(C)C)NC(=O)C(C(C)O)NC(=O)C9CCCN9C(=O)C(CC1=CC=C(C=C1)O)NC(=O)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H](C(=O)N[C@H](C(=O)N[C@H]2CCCCNC(=O)C[C@H](NC(=O)[C@@H]3CCC(=O)OC[C@@H](C(=O)N[C@@H](CC(=O)O1)C(=O)N[C@H](C(=O)N3)CC4=CNC5=CC=CC=C54)NC(=O)[C@@H]6CCCN6C(=O)[C@@H](NC2=O)CC7=CC=C(C=C7)O)C(=O)N[C@@H](CC8=CC=C(C=C8)O)C(=O)O)CC(C)C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H]9CCCN9C(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)C |
| InChI | InChI=1S/C86H108N16O25/c1-43(2)34-58-75(113)90-56-14-8-9-31-87-68(108)39-60(77(115)97-64(86(124)125)37-49-21-27-53(107)28-22-49)93-74(112)57-29-30-69(109)126-42-65(98-80(118)66-15-10-32-101(66)85(123)63(96-73(56)111)36-48-19-25-52(106)26-20-48)79(117)94-61(78(116)92-59(76(114)91-57)38-50-41-88-55-13-7-6-12-54(50)55)40-70(110)127-45(4)72(83(121)95-58)100-82(120)71(44(3)103)99-81(119)67-16-11-33-102(67)84(122)62(89-46(5)104)35-47-17-23-51(105)24-18-47/h6-7,12-13,17-28,41,43-45,56-67,71-72,88,103,105-107H,8-11,14-16,29-40,42H2,1-5H3,(H,87,108)(H,89,104)(H,90,113)(H,91,114)(H,92,116)(H,93,112)(H,94,117)(H,95,121)(H,96,111)(H,97,115)(H,98,118)(H,99,119)(H,100,120)(H,124,125)/t44-,45-,56+,57+,58+,59+,60+,61+,62+,63+,64+,65+,66+,67-,71+,72+/m1/s1 |
| InChI Key | QIXNFZOBUNPVTK-GSCVQPRKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C86H108N16O25 |
| Molecular Weight | 1765.90 g/mol |
| Exact Mass | 1764.76715299 g/mol |
| Topological Polar Surface Area (TPSA) | 606.00 Ų |
| XlogP | 1.40 |
| Atomic LogP (AlogP) | -2.75 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 20 |
| RefChem:158818 |
| 264909-22-0 |
| (2S)-2-((((1S,4S,10S,13S,19S,22S,25S,29R,30S,33S,43S)-33-((2R)-butan-2-yl)-30-(((2S,3R)-1,3-dihydroxy-2-((hydroxy((2S)-1-((2S)-2-((1-hydroxyethylidene)amino)-3-(4-hydroxyphenyl)propanoyl)pyrrolidin-2-yl)methylidene)amino)butylidene)amino)-2,11,21,24,31,34,41,45,47-nonahydroxy-4-((4-hydroxyphenyl)methyl)-22-((1H-indol-3-yl)methyl)-29-methyl-5,16,27-trioxo-15,28-dioxa-3,6,12,20,23,32,35,40,44,46-decaazatetracyclo(17.16.10.2,.0,)heptatetraconta-2,11,20,23,31,34,40,44,46-nonaen-43-yl)(hydroxy)methylidene)amino)-3-(4-hydroxyphenyl)propanoate |
| (2S)-2-(((1S,4S,10S,13S,19S,22S,25S,29R,30S,33S,43S)-30-(((2S,3R)-2-(((2R)-1-((2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl)pyrrolidine-2-carbonyl)amino)-3-hydroxybutanoyl)amino)-4-((4-hydroxyphenyl)methyl)-22-(1H-indol-3-ylmethyl)-29-methyl-33-(2-methylpropyl)-2,5,11,16,21,24,27,31,34,41,45,47-dodecaoxo-15,28-dioxa-3,6,12,20,23,32,35,40,44,46-decazatetracyclo(17.16.10.213,25.06,10)heptatetracontane-43-carbonyl)amino)-3-(4-hydroxyphenyl)propanoic acid |
| (2S)-2-({[(1S,4S,10S,13S,19S,22S,25S,29R,30S,33S,43S)-33-[(2R)-butan-2-yl]-30-{[(2S,3R)-1,3-dihydroxy-2-({hydroxy[(2S)-1-[(2S)-2-[(1-hydroxyethylidene)amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidin-2-yl]methylidene}amino)butylidene]amino}-2,11,21,24,31,34,41,45,47-nonahydroxy-4-[(4-hydroxyphenyl)methyl]-22-[(1H-indol-3-yl)methyl]-29-methyl-5,16,27-trioxo-15,28-dioxa-3,6,12,20,23,32,35,40,44,46-decaazatetracyclo[17.16.10.2,.0,]heptatetraconta-2,11,20,23,31,34,40,44,46-nonaen-43-yl](hydroxy)methylidene}amino)-3-(4-hydroxyphenyl)propanoate |
| (2S)-2-[[(1S,4S,10S,13S,19S,22S,25S,29R,30S,33S,43S)-30-[[(2S,3R)-2-[[(2R)-1-[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoyl]amino]-4-[(4-hydroxyphenyl)methyl]-22-(1H-indol-3-ylmethyl)-29-methyl-33-(2-methylpropyl)-2,5,11,16,21,24,27,31,34,41,45,47-dodecaoxo-15,28-dioxa-3,6,12,20,23,32,35,40,44,46-decazatetracyclo[17.16.10.213,25.06,10]heptatetracontane-43-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| CHEBI:201751 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7342 | 73.42% |
| Caco-2 | - | 0.8642 | 86.42% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Nucleus | 0.3428 | 34.28% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8060 | 80.60% |
| OATP1B3 inhibitior | + | 0.9209 | 92.09% |
| MATE1 inhibitior | - | 0.7209 | 72.09% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9708 | 97.08% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8718 | 87.18% |
| CYP3A4 substrate | + | 0.7640 | 76.40% |
| CYP2C9 substrate | - | 0.5998 | 59.98% |
| CYP2D6 substrate | - | 0.8347 | 83.47% |
| CYP3A4 inhibition | - | 0.5182 | 51.82% |
| CYP2C9 inhibition | - | 0.8096 | 80.96% |
| CYP2C19 inhibition | - | 0.7941 | 79.41% |
| CYP2D6 inhibition | - | 0.8725 | 87.25% |
| CYP1A2 inhibition | - | 0.9442 | 94.42% |
| CYP2C8 inhibition | + | 0.8407 | 84.07% |
| CYP inhibitory promiscuity | - | 0.5951 | 59.51% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5941 | 59.41% |
| Eye corrosion | - | 0.9893 | 98.93% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7976 | 79.76% |
| Skin corrosion | - | 0.9395 | 93.95% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7268 | 72.68% |
| Micronuclear | + | 0.8300 | 83.00% |
| Hepatotoxicity | - | 0.5323 | 53.23% |
| skin sensitisation | - | 0.8971 | 89.71% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | + | 0.5976 | 59.76% |
| Acute Oral Toxicity (c) | III | 0.5732 | 57.32% |
| Estrogen receptor binding | - | 0.4897 | 48.97% |
| Androgen receptor binding | + | 0.7165 | 71.65% |
| Thyroid receptor binding | + | 0.7933 | 79.33% |
| Glucocorticoid receptor binding | + | 0.8351 | 83.51% |
| Aromatase binding | + | 0.8103 | 81.03% |
| PPAR gamma | + | 0.7849 | 78.49% |
| Honey bee toxicity | - | 0.6123 | 61.23% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.9229 | 92.29% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.99% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.47% | 96.61% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.23% | 97.64% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 99.09% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.76% | 90.08% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.62% | 90.20% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 98.47% | 88.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 97.92% | 92.97% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 97.86% | 92.12% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.28% | 85.14% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.13% | 95.38% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.72% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.53% | 89.00% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 96.40% | 99.52% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.55% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.34% | 99.23% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 94.75% | 82.38% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.77% | 98.24% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 93.76% | 96.39% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.65% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.65% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.29% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.13% | 95.89% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.36% | 83.10% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 91.30% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.54% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.47% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.23% | 94.45% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.12% | 91.71% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.89% | 98.59% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.36% | 93.10% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 89.01% | 91.81% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.42% | 98.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.85% | 93.99% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.50% | 95.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.31% | 96.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.80% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.34% | 99.17% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.28% | 92.67% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.94% | 95.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.45% | 83.82% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 84.54% | 97.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.42% | 95.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 84.15% | 100.00% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 83.83% | 82.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 83.50% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.48% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.41% | 94.66% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.40% | 95.83% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 83.31% | 88.10% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.80% | 89.67% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.72% | 90.17% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 82.42% | 88.42% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.21% | 99.15% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.08% | 96.47% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 81.98% | 96.69% |
| CHEMBL204 | P00734 | Thrombin | 81.80% | 96.01% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.35% | 96.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584353 |
| LOTUS | LTS0073745 |
| wikiData | Q77310749 |