Microlobidene
| Internal ID | d58312a1-b158-4f81-a96e-170076f8b8dd |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7-[[(1S,2S,6S,8aS)-6-hydroxy-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]methoxy]chromen-2-one |
| SMILES (Canonical) | CC1CC=C2C(C1(C)COC3=CC4=C(C=C3)C=CC(=O)O4)CCC(C2(C)C)O |
| SMILES (Isomeric) | C[C@H]1CC=C2[C@@H]([C@@]1(C)COC3=CC4=C(C=C3)C=CC(=O)O4)CC[C@@H](C2(C)C)O |
| InChI | InChI=1S/C24H30O4/c1-15-5-9-18-19(10-11-21(25)23(18,2)3)24(15,4)14-27-17-8-6-16-7-12-22(26)28-20(16)13-17/h6-9,12-13,15,19,21,25H,5,10-11,14H2,1-4H3/t15-,19-,21-,24-/m0/s1 |
| InChI Key | LTXNTWWWHIQHCN-ORFALQEDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 4.80 |
| CHEMBL270298 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.57% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.47% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.22% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.87% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.19% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.35% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.82% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.97% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.79% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.46% | 96.95% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.09% | 97.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.97% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.46% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44457257 |
| LOTUS | LTS0042389 |
| wikiData | Q105157260 |