Microginin KR801
| Internal ID | 08adb3da-c242-44cd-adb7-f9fa3be141a8 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2R)-2-[[(2S)-1-[(2S)-2-[[(2R)-2-[[(2S,3S)-10-chloro-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)O)N(C)C(=O)C(CC3=CC=C(C=C3)O)NC(=O)C(C(CCCCCCCCl)NC)O |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](CC2=CC=C(C=C2)O)C(=O)O)N(C)C(=O)[C@@H](CC3=CC=C(C=C3)O)NC(=O)[C@H]([C@H](CCCCCCCCl)NC)O |
| InChI | InChI=1S/C41H60ClN5O9/c1-26(2)23-35(40(54)47-22-10-12-34(47)37(51)45-33(41(55)56)25-28-15-19-30(49)20-16-28)46(4)39(53)32(24-27-13-17-29(48)18-14-27)44-38(52)36(50)31(43-3)11-8-6-5-7-9-21-42/h13-20,26,31-36,43,48-50H,5-12,21-25H2,1-4H3,(H,44,52)(H,45,51)(H,55,56)/t31-,32+,33+,34-,35-,36-/m0/s1 |
| InChI Key | JVWJLDYSLLPVBU-VBBYNRSSSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C41H60ClN5O9 |
| Molecular Weight | 802.40 g/mol |
| Exact Mass | 801.4079562 g/mol |
| Topological Polar Surface Area (TPSA) | 209.00 Ų |
| XlogP | 2.90 |
| Atomic LogP (AlogP) | 3.33 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 23 |
| DTXSID301335487 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5807 | 58.07% |
| Caco-2 | - | 0.8713 | 87.13% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.5887 | 58.87% |
| OATP2B1 inhibitior | - | 0.5755 | 57.55% |
| OATP1B1 inhibitior | + | 0.8638 | 86.38% |
| OATP1B3 inhibitior | + | 0.9200 | 92.00% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9519 | 95.19% |
| P-glycoprotein inhibitior | + | 0.7464 | 74.64% |
| P-glycoprotein substrate | + | 0.8246 | 82.46% |
| CYP3A4 substrate | + | 0.7501 | 75.01% |
| CYP2C9 substrate | - | 0.6005 | 60.05% |
| CYP2D6 substrate | - | 0.7607 | 76.07% |
| CYP3A4 inhibition | + | 0.6340 | 63.40% |
| CYP2C9 inhibition | - | 0.7353 | 73.53% |
| CYP2C19 inhibition | - | 0.7467 | 74.67% |
| CYP2D6 inhibition | - | 0.8355 | 83.55% |
| CYP1A2 inhibition | - | 0.9127 | 91.27% |
| CYP2C8 inhibition | + | 0.5989 | 59.89% |
| CYP inhibitory promiscuity | - | 0.7974 | 79.74% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6169 | 61.69% |
| Eye corrosion | - | 0.9892 | 98.92% |
| Eye irritation | - | 0.9146 | 91.46% |
| Skin irritation | - | 0.7727 | 77.27% |
| Skin corrosion | - | 0.9278 | 92.78% |
| Ames mutagenesis | - | 0.7000 | 70.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4255 | 42.55% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | + | 0.5802 | 58.02% |
| skin sensitisation | - | 0.8811 | 88.11% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.7610 | 76.10% |
| Acute Oral Toxicity (c) | III | 0.6457 | 64.57% |
| Estrogen receptor binding | + | 0.8450 | 84.50% |
| Androgen receptor binding | + | 0.7461 | 74.61% |
| Thyroid receptor binding | + | 0.5452 | 54.52% |
| Glucocorticoid receptor binding | + | 0.6086 | 60.86% |
| Aromatase binding | + | 0.5544 | 55.44% |
| PPAR gamma | + | 0.7502 | 75.02% |
| Honey bee toxicity | - | 0.7839 | 78.39% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.5081 | 50.81% |
| Fish aquatic toxicity | + | 0.9821 | 98.21% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.71% | 96.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.63% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.41% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.94% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.51% | 98.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.93% | 98.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.87% | 93.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.32% | 98.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.95% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.74% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.65% | 95.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.46% | 90.08% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 93.81% | 96.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.61% | 95.89% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 93.10% | 97.79% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.91% | 92.12% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.71% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.43% | 95.89% |
| CHEMBL268 | P43235 | Cathepsin K | 91.45% | 96.85% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.38% | 97.64% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.26% | 97.14% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 91.06% | 95.52% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 90.94% | 92.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.72% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.21% | 95.56% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.51% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.28% | 93.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.04% | 89.63% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.67% | 91.19% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 88.53% | 94.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.80% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.19% | 91.81% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 87.01% | 92.80% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.90% | 90.20% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.59% | 95.34% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.46% | 97.86% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.28% | 94.45% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.39% | 94.66% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.37% | 97.50% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.17% | 85.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 84.04% | 100.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.97% | 97.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.22% | 99.35% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.22% | 93.99% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.66% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.56% | 97.09% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.68% | 96.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.65% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683787 |
| LOTUS | LTS0018304 |
| wikiData | Q105135999 |