Microginin KR781
| Internal ID | fbf1e7d2-eff6-4486-b01e-8a6211afb648 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | methyl (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2R,3R)-2-hydroxy-3-(methylamino)decanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES (Canonical) | CCCCCCCC(C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N(C)C(CC(C)C)C(=O)N2CCCC2C(=O)NC(CC3=CC=C(C=C3)O)C(=O)OC)O)NC |
| SMILES (Isomeric) | CCCCCCC[C@H]([C@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N(C)[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)OC)O)NC |
| InChI | InChI=1S/C42H63N5O9/c1-7-8-9-10-11-13-32(43-4)37(50)39(52)44-33(25-28-15-19-30(48)20-16-28)40(53)46(5)36(24-27(2)3)41(54)47-23-12-14-35(47)38(51)45-34(42(55)56-6)26-29-17-21-31(49)22-18-29/h15-22,27,32-37,43,48-50H,7-14,23-26H2,1-6H3,(H,44,52)(H,45,51)/t32-,33+,34+,35+,36+,37-/m1/s1 |
| InChI Key | FSQHYAPXIVZVRY-OBWIRWOGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H63N5O9 |
| Molecular Weight | 782.00 g/mol |
| Exact Mass | 781.46257860 g/mol |
| Topological Polar Surface Area (TPSA) | 198.00 Ų |
| XlogP | 5.80 |
| Atomic LogP (AlogP) | 3.20 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 22 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4834 | 48.34% |
| Caco-2 | - | 0.8667 | 86.67% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.6588 | 65.88% |
| OATP2B1 inhibitior | - | 0.5717 | 57.17% |
| OATP1B1 inhibitior | + | 0.8601 | 86.01% |
| OATP1B3 inhibitior | + | 0.9086 | 90.86% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9531 | 95.31% |
| P-glycoprotein inhibitior | + | 0.7612 | 76.12% |
| P-glycoprotein substrate | + | 0.8548 | 85.48% |
| CYP3A4 substrate | + | 0.7518 | 75.18% |
| CYP2C9 substrate | - | 0.7936 | 79.36% |
| CYP2D6 substrate | - | 0.7118 | 71.18% |
| CYP3A4 inhibition | + | 0.6500 | 65.00% |
| CYP2C9 inhibition | - | 0.7357 | 73.57% |
| CYP2C19 inhibition | - | 0.7685 | 76.85% |
| CYP2D6 inhibition | - | 0.8151 | 81.51% |
| CYP1A2 inhibition | - | 0.9240 | 92.40% |
| CYP2C8 inhibition | + | 0.6757 | 67.57% |
| CYP inhibitory promiscuity | - | 0.7089 | 70.89% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.6854 | 68.54% |
| Eye corrosion | - | 0.9904 | 99.04% |
| Eye irritation | - | 0.9161 | 91.61% |
| Skin irritation | - | 0.7884 | 78.84% |
| Skin corrosion | - | 0.9363 | 93.63% |
| Ames mutagenesis | - | 0.8637 | 86.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4611 | 46.11% |
| Micronuclear | + | 0.7500 | 75.00% |
| Hepatotoxicity | + | 0.5534 | 55.34% |
| skin sensitisation | - | 0.8972 | 89.72% |
| Respiratory toxicity | + | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.7611 | 76.11% |
| Acute Oral Toxicity (c) | III | 0.6749 | 67.49% |
| Estrogen receptor binding | + | 0.8505 | 85.05% |
| Androgen receptor binding | + | 0.7545 | 75.45% |
| Thyroid receptor binding | + | 0.5388 | 53.88% |
| Glucocorticoid receptor binding | + | 0.6668 | 66.68% |
| Aromatase binding | + | 0.5330 | 53.30% |
| PPAR gamma | + | 0.7738 | 77.38% |
| Honey bee toxicity | - | 0.7926 | 79.26% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.5452 | 54.52% |
| Fish aquatic toxicity | + | 0.9885 | 98.85% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.95% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.84% | 96.61% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.61% | 89.63% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 99.24% | 91.81% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.01% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.19% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.80% | 98.33% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.10% | 98.10% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 95.97% | 100.00% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 95.80% | 92.12% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.42% | 92.86% |
| CHEMBL268 | P43235 | Cathepsin K | 95.16% | 96.85% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.14% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.93% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.91% | 97.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.84% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.71% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.64% | 97.64% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.81% | 93.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.63% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.61% | 91.19% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.50% | 95.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.22% | 90.08% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.18% | 95.89% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 92.84% | 97.79% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 92.27% | 94.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.19% | 93.56% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 91.44% | 96.67% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.37% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.71% | 94.66% |
| CHEMBL240 | Q12809 | HERG | 90.55% | 89.76% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.42% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.24% | 94.45% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.21% | 98.24% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.18% | 97.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.97% | 97.29% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.61% | 82.38% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.82% | 99.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.14% | 95.56% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 86.05% | 95.34% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.36% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.28% | 94.33% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.23% | 97.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.18% | 96.90% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.85% | 90.20% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 84.58% | 92.86% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 83.81% | 97.50% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 83.48% | 100.00% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 82.42% | 97.29% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.85% | 96.38% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.55% | 95.38% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 80.92% | 95.52% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.90% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683784 |
| LOTUS | LTS0233327 |
| wikiData | Q104246148 |