Microginin 715
| Internal ID | b4e75f03-56a1-4e43-a226-ef62db84699d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | 2-[[2-[[1-[2-[(2-amino-9-chlorononyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC(C)C(C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)NCC(CCCCCCCCl)N |
| SMILES (Isomeric) | CC(C)C(C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)NCC(CCCCCCCCl)N |
| InChI | InChI=1S/C37H54ClN5O7/c1-24(2)33(40-23-27(39)9-6-4-3-5-7-19-38)36(48)43-20-8-10-32(43)35(47)41-30(21-25-11-15-28(44)16-12-25)34(46)42-31(37(49)50)22-26-13-17-29(45)18-14-26/h11-18,24,27,30-33,40,44-45H,3-10,19-23,39H2,1-2H3,(H,41,47)(H,42,46)(H,49,50) |
| InChI Key | DQFXPMMPHQQNFQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H54ClN5O7 |
| Molecular Weight | 716.30 g/mol |
| Exact Mass | 715.3711768 g/mol |
| Topological Polar Surface Area (TPSA) | 194.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 3.45 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 21 |
| DTXSID001047219 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8128 | 81.28% |
| Caco-2 | - | 0.8853 | 88.53% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.5687 | 56.87% |
| OATP2B1 inhibitior | - | 0.5740 | 57.40% |
| OATP1B1 inhibitior | + | 0.8937 | 89.37% |
| OATP1B3 inhibitior | + | 0.9387 | 93.87% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9547 | 95.47% |
| P-glycoprotein inhibitior | + | 0.7323 | 73.23% |
| P-glycoprotein substrate | + | 0.7673 | 76.73% |
| CYP3A4 substrate | + | 0.7056 | 70.56% |
| CYP2C9 substrate | - | 0.8078 | 80.78% |
| CYP2D6 substrate | - | 0.8024 | 80.24% |
| CYP3A4 inhibition | + | 0.5796 | 57.96% |
| CYP2C9 inhibition | - | 0.7676 | 76.76% |
| CYP2C19 inhibition | - | 0.6675 | 66.75% |
| CYP2D6 inhibition | - | 0.8577 | 85.77% |
| CYP1A2 inhibition | - | 0.9186 | 91.86% |
| CYP2C8 inhibition | + | 0.4912 | 49.12% |
| CYP inhibitory promiscuity | - | 0.7961 | 79.61% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.7000 | 70.00% |
| Carcinogenicity (trinary) | Non-required | 0.5820 | 58.20% |
| Eye corrosion | - | 0.9907 | 99.07% |
| Eye irritation | - | 0.9197 | 91.97% |
| Skin irritation | - | 0.7775 | 77.75% |
| Skin corrosion | - | 0.9300 | 93.00% |
| Ames mutagenesis | - | 0.6600 | 66.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3938 | 39.38% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | + | 0.5157 | 51.57% |
| skin sensitisation | - | 0.8924 | 89.24% |
| Respiratory toxicity | + | 0.9000 | 90.00% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | - | 0.8065 | 80.65% |
| Acute Oral Toxicity (c) | III | 0.6824 | 68.24% |
| Estrogen receptor binding | + | 0.8232 | 82.32% |
| Androgen receptor binding | + | 0.6709 | 67.09% |
| Thyroid receptor binding | + | 0.5484 | 54.84% |
| Glucocorticoid receptor binding | + | 0.6834 | 68.34% |
| Aromatase binding | + | 0.5571 | 55.71% |
| PPAR gamma | + | 0.7297 | 72.97% |
| Honey bee toxicity | - | 0.8703 | 87.03% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5572 | 55.72% |
| Fish aquatic toxicity | + | 0.9469 | 94.69% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.74% | 93.10% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.26% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.83% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.55% | 94.45% |
| CHEMBL3837 | P07711 | Cathepsin L | 96.90% | 96.61% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.49% | 95.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 96.08% | 96.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.59% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.07% | 99.17% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 93.67% | 98.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.13% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.93% | 95.89% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.39% | 97.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.89% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.52% | 93.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.24% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.71% | 97.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.81% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.18% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.47% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.39% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.27% | 91.19% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 87.12% | 92.86% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.78% | 96.47% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 86.66% | 97.79% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.38% | 100.00% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 84.46% | 93.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.42% | 95.89% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 83.41% | 96.67% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 83.11% | 99.17% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 83.10% | 92.22% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.00% | 96.03% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.15% | 82.86% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.57% | 97.50% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 81.51% | 95.52% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 81.46% | 92.80% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.35% | 97.14% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.31% | 85.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.28% | 95.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.23% | 93.67% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.17% | 94.00% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 80.85% | 93.39% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.40% | 90.24% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.12% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684932 |
| LOTUS | LTS0222580 |
| wikiData | Q104246234 |