Microginin 713B
| Internal ID | 69a4371f-71c4-4233-a992-c5e27dccf4da |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-[[2-[[1-[2-[(3-amino-2-hydroxydecanoyl)amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCCCCCCC(C(C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)O)N |
| SMILES (Isomeric) | CCCCCCCC(C(C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)O)N |
| InChI | InChI=1S/C36H51N5O10/c1-2-3-4-5-6-8-26(37)31(45)34(48)40-29(21-42)35(49)41-18-7-9-30(41)33(47)38-27(19-22-10-14-24(43)15-11-22)32(46)39-28(36(50)51)20-23-12-16-25(44)17-13-23/h10-17,26-31,42-45H,2-9,18-21,37H2,1H3,(H,38,47)(H,39,46)(H,40,48)(H,50,51) |
| InChI Key | JSVJSIBNAWXLCR-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C36H51N5O10 |
| Molecular Weight | 713.80 g/mol |
| Exact Mass | 713.36359284 g/mol |
| Topological Polar Surface Area (TPSA) | 252.00 Ų |
| XlogP | 0.10 |
| 2-[[2-[[1-[2-[(3-amino-2-hydroxydecanoyl)amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| 2-((2-(((1-(2-((3-amino-1,2-dihydroxydecylidene)amino)-3-hydroxypropanoyl)pyrrolidin-2-yl)(hydroxy)methylidene)amino)-1-hydroxy-3-(4-hydroxyphenyl)propylidene)amino)-3-(4-hydroxyphenyl)propanoate |
| 2-((2-((1-(2-((3-amino-2-hydroxydecanoyl)amino)-3-hydroxypropanoyl)pyrrolidine-2-carbonyl)amino)-3-(4-hydroxyphenyl)propanoyl)amino)-3-(4-hydroxyphenyl)propanoic acid |
| 2-[(2-{[(1-{2-[(3-amino-1,2-dihydroxydecylidene)amino]-3-hydroxypropanoyl}pyrrolidin-2-yl)(hydroxy)methylidene]amino}-1-hydroxy-3-(4-hydroxyphenyl)propylidene)amino]-3-(4-hydroxyphenyl)propanoate |
| RefChem:158615 |
| CHEBI:222241 |
| DTXSID601335486 |
| N-(3-Amino-2-hydroxydecanoyl)serylprolyltyrosyltyrosine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.84% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.30% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.53% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.46% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.08% | 93.10% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 97.69% | 91.81% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 97.31% | 96.67% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.86% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.78% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.65% | 99.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.51% | 96.61% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.31% | 83.82% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 95.11% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.07% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.01% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.77% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.48% | 90.71% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 93.41% | 97.79% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.82% | 97.29% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.74% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.36% | 97.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.12% | 97.64% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.34% | 95.89% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.56% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.46% | 92.86% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.94% | 96.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.33% | 95.56% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.83% | 97.93% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.32% | 93.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.85% | 95.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.78% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.65% | 82.69% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 85.37% | 98.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.25% | 91.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.02% | 97.14% |
| CHEMBL2319 | P06870 | Kallikrein 1 | 84.41% | 90.95% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.77% | 95.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.14% | 92.08% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.97% | 95.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.94% | 95.50% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 82.74% | 99.17% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.51% | 97.23% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.23% | 98.10% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.19% | 97.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.88% | 99.35% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.43% | 90.17% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 80.85% | 98.89% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 80.74% | 93.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.69% | 96.95% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.59% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684936 |
| LOTUS | LTS0222005 |
| wikiData | Q104246246 |