Microginin 51-A
| Internal ID | 544727cd-098f-406d-b78a-b26cd23a0426 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-2-[[(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-2-hydroxydecanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCCCCCCC(C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N(C)C(C(C)C)C(=O)N(C)C(CC2=CC=C(C=C2)O)C(=O)N3CCCC3C(=O)NC(CC4=CC=C(C=C4)O)C(=O)O)O)N |
| SMILES (Isomeric) | CCCCCCC[C@@H]([C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](CC2=CC=C(C=C2)O)C(=O)N3CCC[C@@H]3C(=O)N[C@@H](CC4=CC=C(C=C4)O)C(=O)O)O)N |
| InChI | InChI=1S/C49H68N6O11/c1-6-7-8-9-10-12-37(50)43(59)45(61)51-38(27-31-14-20-34(56)21-15-31)46(62)54(5)42(30(2)3)48(64)53(4)41(29-33-18-24-36(58)25-19-33)47(63)55-26-11-13-40(55)44(60)52-39(49(65)66)28-32-16-22-35(57)23-17-32/h14-25,30,37-43,56-59H,6-13,26-29,50H2,1-5H3,(H,51,61)(H,52,60)(H,65,66)/t37-,38-,39-,40+,41-,42-,43-/m0/s1 |
| InChI Key | KNCUIJOWAGGZPU-ZRBRQIMBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H68N6O11 |
| Molecular Weight | 917.10 g/mol |
| Exact Mass | 916.49460701 g/mol |
| Topological Polar Surface Area (TPSA) | 263.00 Ų |
| XlogP | 3.50 |
| Atomic LogP (AlogP) | 3.24 |
| H-Bond Acceptor | 11 |
| H-Bond Donor | 8 |
| Rotatable Bonds | 24 |
| CHEBI:201256 |
| (2S)-2-[[(2R)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-2-hydroxydecanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4887 | 48.87% |
| Caco-2 | - | 0.8694 | 86.94% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Mitochondria | 0.5296 | 52.96% |
| OATP2B1 inhibitior | - | 0.7160 | 71.60% |
| OATP1B1 inhibitior | + | 0.8626 | 86.26% |
| OATP1B3 inhibitior | + | 0.9177 | 91.77% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9715 | 97.15% |
| P-glycoprotein inhibitior | + | 0.7468 | 74.68% |
| P-glycoprotein substrate | + | 0.8281 | 82.81% |
| CYP3A4 substrate | + | 0.7106 | 71.06% |
| CYP2C9 substrate | - | 0.5962 | 59.62% |
| CYP2D6 substrate | - | 0.7669 | 76.69% |
| CYP3A4 inhibition | + | 0.5668 | 56.68% |
| CYP2C9 inhibition | - | 0.8058 | 80.58% |
| CYP2C19 inhibition | - | 0.8201 | 82.01% |
| CYP2D6 inhibition | - | 0.8606 | 86.06% |
| CYP1A2 inhibition | - | 0.9233 | 92.33% |
| CYP2C8 inhibition | + | 0.5122 | 51.22% |
| CYP inhibitory promiscuity | - | 0.8865 | 88.65% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.6667 | 66.67% |
| Eye corrosion | - | 0.9898 | 98.98% |
| Eye irritation | - | 0.9060 | 90.60% |
| Skin irritation | - | 0.7871 | 78.71% |
| Skin corrosion | - | 0.9282 | 92.82% |
| Ames mutagenesis | - | 0.8500 | 85.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6416 | 64.16% |
| Micronuclear | + | 0.7400 | 74.00% |
| Hepatotoxicity | + | 0.5816 | 58.16% |
| skin sensitisation | - | 0.8846 | 88.46% |
| Respiratory toxicity | + | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.8748 | 87.48% |
| Acute Oral Toxicity (c) | III | 0.6458 | 64.58% |
| Estrogen receptor binding | + | 0.8471 | 84.71% |
| Androgen receptor binding | + | 0.7291 | 72.91% |
| Thyroid receptor binding | + | 0.5774 | 57.74% |
| Glucocorticoid receptor binding | + | 0.5978 | 59.78% |
| Aromatase binding | + | 0.5454 | 54.54% |
| PPAR gamma | + | 0.7882 | 78.82% |
| Honey bee toxicity | - | 0.8470 | 84.70% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5124 | 51.24% |
| Fish aquatic toxicity | + | 0.9814 | 98.14% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.20% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.84% | 89.63% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.68% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.01% | 96.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.67% | 93.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.45% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.11% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.54% | 99.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 96.00% | 96.67% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 95.74% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.90% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.00% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.66% | 95.89% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.51% | 92.86% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.27% | 91.76% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.22% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.00% | 91.19% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.89% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.54% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.42% | 90.20% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.41% | 97.93% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.14% | 90.08% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.84% | 91.81% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.75% | 90.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.22% | 97.29% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.90% | 97.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.70% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.54% | 98.24% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.48% | 97.64% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.34% | 95.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 88.68% | 99.35% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.43% | 94.45% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.76% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.39% | 97.14% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 85.96% | 99.17% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 84.78% | 92.86% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.61% | 98.10% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.15% | 93.99% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.93% | 94.33% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.34% | 96.37% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 81.73% | 97.23% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.45% | 82.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.32% | 94.66% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584280 |
| LOTUS | LTS0260383 |
| wikiData | Q77310076 |