Microginin 299A
| Internal ID | cf3ab79e-9473-4a05-85e3-f843082a9fe7 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC(C)C(C(=O)N(C)C(C(C)C)C(=O)N(C)C(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)NC(=O)C(C(CCCCCCCCl)N)O |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)N(C)[C@@H](C(C)C)C(=O)N(C)[C@@H](CC1=CC=C(C=C1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)O)NC(=O)[C@H]([C@H](CCCCCCCCl)N)O |
| InChI | InChI=1S/C45H67ClN6O10/c1-27(2)37(49-41(57)39(55)33(47)13-10-8-7-9-11-23-46)43(59)51(6)38(28(3)4)44(60)50(5)36(26-30-17-21-32(54)22-18-30)42(58)52-24-12-14-35(52)40(56)48-34(45(61)62)25-29-15-19-31(53)20-16-29/h15-22,27-28,33-39,53-55H,7-14,23-26,47H2,1-6H3,(H,48,56)(H,49,57)(H,61,62)/t33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| InChI Key | GTUNZCVHPMEXMH-ZTYVOHGWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H67ClN6O10 |
| Molecular Weight | 887.50 g/mol |
| Exact Mass | 886.4607200 g/mol |
| Topological Polar Surface Area (TPSA) | 243.00 Ų |
| XlogP | 2.90 |
| Atomic LogP (AlogP) | 3.16 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 7 |
| Rotatable Bonds | 24 |
| Microginin 299-A |
| RefChem:158586 |
| 194475-27-9 |
| SCHEMBL29885234 |
| CHEBI:213809 |
| (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6143 | 61.43% |
| Caco-2 | - | 0.8659 | 86.59% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Mitochondria | 0.5155 | 51.55% |
| OATP2B1 inhibitior | - | 0.5772 | 57.72% |
| OATP1B1 inhibitior | + | 0.8706 | 87.06% |
| OATP1B3 inhibitior | + | 0.9315 | 93.15% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9366 | 93.66% |
| P-glycoprotein inhibitior | + | 0.7436 | 74.36% |
| P-glycoprotein substrate | + | 0.8356 | 83.56% |
| CYP3A4 substrate | + | 0.7331 | 73.31% |
| CYP2C9 substrate | - | 0.5966 | 59.66% |
| CYP2D6 substrate | - | 0.7804 | 78.04% |
| CYP3A4 inhibition | - | 0.5265 | 52.65% |
| CYP2C9 inhibition | - | 0.8425 | 84.25% |
| CYP2C19 inhibition | - | 0.7915 | 79.15% |
| CYP2D6 inhibition | - | 0.8543 | 85.43% |
| CYP1A2 inhibition | - | 0.8987 | 89.87% |
| CYP2C8 inhibition | + | 0.5714 | 57.14% |
| CYP inhibitory promiscuity | - | 0.8540 | 85.40% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6047 | 60.47% |
| Eye corrosion | - | 0.9889 | 98.89% |
| Eye irritation | - | 0.9064 | 90.64% |
| Skin irritation | - | 0.7706 | 77.06% |
| Skin corrosion | - | 0.9294 | 92.94% |
| Ames mutagenesis | - | 0.6500 | 65.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3898 | 38.98% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | + | 0.5459 | 54.59% |
| skin sensitisation | - | 0.8781 | 87.81% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9250 | 92.50% |
| Nephrotoxicity | - | 0.8162 | 81.62% |
| Acute Oral Toxicity (c) | III | 0.6318 | 63.18% |
| Estrogen receptor binding | + | 0.8468 | 84.68% |
| Androgen receptor binding | + | 0.7216 | 72.16% |
| Thyroid receptor binding | + | 0.5892 | 58.92% |
| Glucocorticoid receptor binding | + | 0.6079 | 60.79% |
| Aromatase binding | + | 0.5370 | 53.70% |
| PPAR gamma | + | 0.7844 | 78.44% |
| Honey bee toxicity | - | 0.7876 | 78.76% |
| Biodegradation | - | 0.9000 | 90.00% |
| Crustacea aquatic toxicity | - | 0.5605 | 56.05% |
| Fish aquatic toxicity | + | 0.9462 | 94.62% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.82% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 99.49% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.24% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.48% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.91% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.71% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.80% | 99.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.93% | 96.67% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.79% | 90.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.36% | 93.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.67% | 90.24% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.55% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.15% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.14% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.86% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.58% | 95.89% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.06% | 91.76% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.76% | 98.24% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.42% | 95.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.31% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.30% | 95.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.19% | 100.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.91% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.56% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.45% | 91.19% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.42% | 93.99% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 88.34% | 82.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.94% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.47% | 100.00% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 86.57% | 95.52% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 86.54% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.50% | 96.47% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.44% | 89.67% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.22% | 90.20% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 84.83% | 96.03% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 84.62% | 97.23% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.53% | 95.34% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.40% | 83.82% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.38% | 94.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.25% | 90.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.07% | 97.64% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.79% | 95.00% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 83.46% | 92.86% |
| CHEMBL233 | P35372 | Mu opioid receptor | 82.91% | 97.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.90% | 97.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.82% | 90.17% |
| CHEMBL4072 | P07858 | Cathepsin B | 82.32% | 93.67% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.74% | 94.66% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.44% | 96.37% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.22% | 88.56% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.19% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10056525 |
| LOTUS | LTS0234257 |
| wikiData | Q77496087 |