Michellamine A
Internal ID | 9d506a96-9850-45c8-bd43-8271de901acf |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
IUPAC Name | (1S,3S)-5-[3-[4-[(1S,3S)-6,8-dihydroxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-5-yl]-1-hydroxy-8-methoxy-6-methylnaphthalen-2-yl]-4-hydroxy-5-methoxy-7-methylnaphthalen-1-yl]-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
SMILES (Canonical) | CC1CC2=C(C(=CC(=C2C(N1)C)O)O)C3=CC(=C(C4=C3C=C(C=C4OC)C)O)C5=C(C6=C(C=C(C=C6OC)C)C(=C5)C7=C8CC(NC(C8=C(C=C7O)O)C)C)O |
SMILES (Isomeric) | C[C@H]1CC2=C(C(=CC(=C2[C@@H](N1)C)O)O)C3=CC(=C(C4=C3C=C(C=C4OC)C)O)C5=C(C6=C(C=C(C=C6OC)C)C(=C5)C7=C8C[C@@H](N[C@H](C8=C(C=C7O)O)C)C)O |
InChI | InChI=1S/C46H48N2O8/c1-19-9-25-27(41-31-13-21(3)47-23(5)39(31)33(49)17-35(41)51)15-29(45(53)43(25)37(11-19)55-7)30-16-28(26-10-20(2)12-38(56-8)44(26)46(30)54)42-32-14-22(4)48-24(6)40(32)34(50)18-36(42)52/h9-12,15-18,21-24,47-54H,13-14H2,1-8H3/t21-,22-,23-,24-/m0/s1 |
InChI Key | GMLBVLXDRNJFGR-ZJZGAYNASA-N |
Popularity | 17 references in papers |
Molecular Formula | C46H48N2O8 |
Molecular Weight | 756.90 g/mol |
Exact Mass | 756.34106649 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | 8.30 |
Michellamine B |
CHEBI:66385 |
Michellamine |
NSC661755 |
NSC649324 |
NSC650898 |
(1S,3S)-5-[3-[4-[(1S,3S)-6,8-dihydroxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-5-yl]-1-hydroxy-8-methoxy-6-methyl-2-naphthyl]-4-hydroxy-5-methoxy-7-methyl-1-naphthyl]-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
(-)-Michellamine B |
CHEMBL325222 |
CHEBI:66386 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.11% | 92.94% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.11% | 91.79% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.46% | 91.49% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 92.43% | 95.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.15% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.14% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 91.01% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.92% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.67% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.54% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.28% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.55% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.44% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 86.29% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.81% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.76% | 97.09% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 83.62% | 88.48% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.40% | 97.31% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 82.29% | 91.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.98% | 99.15% |
CHEMBL5747 | Q92793 | CREB-binding protein | 81.80% | 95.12% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.20% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ancistrocladus abbreviatus |
Ancistrocladus korupensis |
PubChem | 453654 |
NPASS | NPC119068 |
ChEMBL | CHEMBL325222 |
LOTUS | LTS0021735 |
wikiData | Q105012010 |