Mezzettiaside 9
Internal ID | d2d861e4-b516-43dc-acb1-b4f0bf964192 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,4-diacetyloxy-5-hydroxy-6-methyloxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCCCCOC1C(C(C(C(O1)C)OC(=O)CCCCC)OC2C(C(C(C(O2)C)O)OC(=O)C)OC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)OC(=O)C)OC(=O)C)O |
InChI | InChI=1S/C30H52O12/c1-7-9-11-12-13-15-17-36-29-24(35)27(25(19(4)38-29)41-22(33)16-14-10-8-2)42-30-28(40-21(6)32)26(39-20(5)31)23(34)18(3)37-30/h18-19,23-30,34-35H,7-17H2,1-6H3/t18-,19-,23-,24+,25-,26+,27-,28+,29+,30-/m0/s1 |
InChI Key | RDCMFBVGEZABQK-UWVAMOTESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H52O12 |
Molecular Weight | 604.70 g/mol |
Exact Mass | 604.34587709 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 4.40 |
CHEMBL443164 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.26% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.93% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.27% | 91.11% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.74% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.22% | 92.08% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.59% | 97.29% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.17% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.67% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.24% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.80% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.19% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.54% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.18% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.01% | 91.19% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.71% | 91.81% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.52% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.41% | 99.23% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.17% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.16% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mezzettia parviflora |
PubChem | 10054386 |
NPASS | NPC50228 |
ChEMBL | CHEMBL443164 |
LOTUS | LTS0197297 |
wikiData | Q105234144 |