Mezzettiaside 8
Internal ID | be4e29d1-0be7-45b0-9160-b10e39b0512b |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-4-[(2S,3R,4R,5R,6S)-3-acetyloxy-4,5-dihydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCCCCOC1C(C(C(C(O1)C)OC(=O)CCCCC)OC2C(C(C(C(O2)C)OC(=O)C)OC3C(C(C(C(O3)C)O)O)OC(=O)C)OC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)OC(=O)C)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O)O)OC(=O)C)OC(=O)C)O |
InChI | InChI=1S/C38H64O17/c1-9-11-13-14-15-17-19-46-36-29(45)32(30(21(4)48-36)53-26(42)18-16-12-10-2)54-38-35(52-25(8)41)34(31(22(5)49-38)50-23(6)39)55-37-33(51-24(7)40)28(44)27(43)20(3)47-37/h20-22,27-38,43-45H,9-19H2,1-8H3/t20-,21-,22-,27-,28+,29+,30-,31-,32-,33+,34+,35+,36+,37-,38-/m0/s1 |
InChI Key | RFBUDPHMUJKWKY-SHJIKHEYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H64O17 |
Molecular Weight | 792.90 g/mol |
Exact Mass | 792.41435057 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 3.90 |
CHEMBL505158 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.69% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.35% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.03% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.93% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.80% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.50% | 92.08% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.40% | 85.94% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.34% | 97.29% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.41% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.89% | 91.49% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.90% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.67% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.26% | 96.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.13% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.95% | 86.33% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 83.01% | 91.83% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.85% | 94.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.33% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.37% | 99.23% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.01% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.17% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mezzettia parviflora |
PubChem | 9987864 |
NPASS | NPC169085 |
ChEMBL | CHEMBL505158 |
LOTUS | LTS0013720 |
wikiData | Q105235275 |