Mezzettiaside 4
Internal ID | 24ff10d0-8f83-461d-a7a4-d523d9ad925f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-4-[(2S,3R,4S,5R,6S)-5-acetyloxy-3,4-dihydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCCCCOC1C(C(C(C(O1)C)OC(=O)CCCCC)OC2C(C(C(C(O2)C)OC(=O)C)OC3C(C(C(C(O3)C)OC(=O)C)O)O)OC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)OC(=O)C)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)OC(=O)C)O)O)OC(=O)C)O |
InChI | InChI=1S/C38H64O17/c1-9-11-13-14-15-17-19-46-36-29(45)33(31(21(4)47-36)53-26(42)18-16-12-10-2)54-38-35(52-25(8)41)34(32(22(5)49-38)51-24(7)40)55-37-28(44)27(43)30(20(3)48-37)50-23(6)39/h20-22,27-38,43-45H,9-19H2,1-8H3/t20-,21-,22-,27-,28+,29+,30-,31-,32-,33-,34+,35+,36+,37-,38-/m0/s1 |
InChI Key | UWRBANIXXKCENR-CXRZNAPFSA-N |
Popularity | 2 references in papers |
Molecular Formula | C38H64O17 |
Molecular Weight | 792.90 g/mol |
Exact Mass | 792.41435057 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 3.90 |
CHEMBL498846 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.49% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.15% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.56% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.74% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.53% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.96% | 92.08% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.55% | 85.94% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.76% | 97.29% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.93% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.55% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.03% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.10% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.90% | 94.33% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.33% | 92.86% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.71% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.51% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.26% | 97.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.54% | 96.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.46% | 99.23% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.90% | 82.50% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.59% | 91.81% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.17% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mezzettia parviflora |
PubChem | 10350348 |
NPASS | NPC9763 |
ChEMBL | CHEMBL498846 |
LOTUS | LTS0155238 |
wikiData | Q105280510 |