Mezzettiaside 3
Internal ID | 09a469de-3774-485e-b394-19df28335151 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4S,5R,6R)-4-[(2S,3R,4R,5S,6S)-3,5-diacetyloxy-4-[(2S,3R,4S,5S,6S)-4,5-diacetyloxy-3-hydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-2-methyl-6-octoxyoxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCCCCOC1C(C(C(C(O1)C)OC(=O)CCCCC)OC2C(C(C(C(O2)C)OC(=O)C)OC3C(C(C(C(O3)C)OC(=O)C)OC(=O)C)O)OC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCO[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)CCCCC)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)OC(=O)C)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)OC(=O)C)OC(=O)C)O)OC(=O)C)O |
InChI | InChI=1S/C40H66O18/c1-10-12-14-15-16-18-20-48-38-29(46)35(32(22(4)49-38)56-28(45)19-17-13-11-2)57-40-37(55-27(9)44)36(33(23(5)51-40)53-25(7)42)58-39-30(47)34(54-26(8)43)31(21(3)50-39)52-24(6)41/h21-23,29-40,46-47H,10-20H2,1-9H3/t21-,22-,23-,29+,30+,31-,32-,33-,34-,35-,36+,37+,38+,39-,40-/m0/s1 |
InChI Key | DBTGYAVTHIAQRY-NCUXRCQESA-N |
Popularity | 3 references in papers |
Molecular Formula | C40H66O18 |
Molecular Weight | 834.90 g/mol |
Exact Mass | 834.42491525 g/mol |
Topological Polar Surface Area (TPSA) | 227.00 Ų |
XlogP | 4.50 |
CHEMBL450202 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.43% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.10% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.74% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.64% | 91.11% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.64% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.22% | 92.08% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.32% | 97.29% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.70% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.24% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.10% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.63% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.71% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.51% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.77% | 97.36% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.46% | 99.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.91% | 97.25% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.59% | 91.81% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.57% | 96.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.17% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.08% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mezzettia parviflora |
PubChem | 10328148 |
NPASS | NPC39266 |
ChEMBL | CHEMBL450202 |
LOTUS | LTS0170822 |
wikiData | Q104398006 |