Methylselenic acid
| Internal ID | f4c6f9ef-a88d-42db-bf22-70250979918d |
| Taxonomy | Organic acids and derivatives > Seleninic acids and derivatives |
| IUPAC Name | methaneseleninic acid |
| SMILES (Canonical) | C[Se](=O)O |
| SMILES (Isomeric) | C[Se](=O)O |
| InChI | InChI=1S/CH4O2Se/c1-4(2)3/h1H3,(H,2,3) |
| InChI Key | UEQANLFPOFICBH-UHFFFAOYSA-N |
| Popularity | 297 references in papers |
| Molecular Formula | CH4O2Se |
| Molecular Weight | 127.01 g/mol |
| Exact Mass | 127.93765 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 0.00 |
| Methylselenic acid |
| Methylseleninic acid |
| 28274-57-9 |
| methylseleninate |
| CHEBI:77012 |
| UNII-9900C6V162 |
| 9900C6V162 |
| Methaneseleninic acid(6CI,8CI,9CI) |
| Methyl seleninic acid |
| NSC-243621 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.90% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium sativum |
| PubChem | 161597 |
| NPASS | NPC74400 |
| ChEMBL | CHEMBL399906 |