Methylene-bis-methylphlorobutyrophenone
Internal ID | 4244f6ab-e938-4aa5-a44f-d6c717437a09 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
IUPAC Name | 1-[3-[(3-butanoyl-2,4,6-trihydroxy-5-methylphenyl)methyl]-2,4,6-trihydroxy-5-methylphenyl]butan-1-one |
SMILES (Canonical) | CCCC(=O)C1=C(C(=C(C(=C1O)CC2=C(C(=C(C(=C2O)C)O)C(=O)CCC)O)O)C)O |
SMILES (Isomeric) | CCCC(=O)C1=C(C(=C(C(=C1O)CC2=C(C(=C(C(=C2O)C)O)C(=O)CCC)O)O)C)O |
InChI | InChI=1S/C23H28O8/c1-5-7-14(24)16-20(28)10(3)18(26)12(22(16)30)9-13-19(27)11(4)21(29)17(23(13)31)15(25)8-6-2/h26-31H,5-9H2,1-4H3 |
InChI Key | JBOIEATWPCRELN-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H28O8 |
Molecular Weight | 432.50 g/mol |
Exact Mass | 432.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 4.60 |
methylene-bis-methylphlorobutyrophenone |
Abbreviatin BB |
BDBM50191686 |
4069-49-2 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4158 | P49327 | Fatty acid synthase |
25400 nM |
IC50 |
PMID: 16870425
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 91.87% | 98.95% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.10% | 89.34% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.08% | 90.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.57% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.62% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.21% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.49% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.54% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.43% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dryopteris crassirhizoma |
PubChem | 16046225 |
NPASS | NPC229649 |
ChEMBL | CHEMBL213124 |
LOTUS | LTS0045072 |
wikiData | Q105124473 |