Methyl galbanate
Internal ID | 78ebcc87-3ee8-4b1f-80b8-f6bde52075d8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | methyl 3-[(1S,2S,3S)-2,3-dimethyl-2-[(2-oxochromen-7-yl)oxymethyl]-6-propan-2-ylidenecyclohexyl]propanoate |
SMILES (Canonical) | CC1CCC(=C(C)C)C(C1(C)COC2=CC3=C(C=C2)C=CC(=O)O3)CCC(=O)OC |
SMILES (Isomeric) | C[C@H]1CCC(=C(C)C)[C@@H]([C@@]1(C)COC2=CC3=C(C=C2)C=CC(=O)O3)CCC(=O)OC |
InChI | InChI=1S/C25H32O5/c1-16(2)20-10-6-17(3)25(4,21(20)11-13-23(26)28-5)15-29-19-9-7-18-8-12-24(27)30-22(18)14-19/h7-9,12,14,17,21H,6,10-11,13,15H2,1-5H3/t17-,21-,25-/m0/s1 |
InChI Key | LWKZASDDSMSRFV-ADSMNUKGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H32O5 |
Molecular Weight | 412.50 g/mol |
Exact Mass | 412.22497412 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 5.50 |
CHEMBL1078629 |
SCHEMBL15080626 |
DTXSID701346507 |
AKOS030489036 |
1206911-10-5 |
53696-76-7 |
![2D Structure of Methyl galbanate 2D Structure of Methyl galbanate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-galbanate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.82% | 96.09% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.40% | 97.53% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.16% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.43% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.86% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.46% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.74% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.36% | 92.62% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.70% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.48% | 90.00% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 84.15% | 92.51% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.82% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 83.36% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.60% | 91.07% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.85% | 90.71% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 81.29% | 90.48% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.21% | 92.94% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.06% | 97.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.63% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula assa-foetida |
PubChem | 7075765 |
LOTUS | LTS0169650 |
wikiData | Q104400151 |