methyl (E)-9-[(1E,3Z)-nona-1,3-dienoxy]non-8-enoate
| Internal ID | 7cac711f-590a-470f-85b9-ddda7791bed9 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acid esters > Fatty acid methyl esters |
| IUPAC Name | methyl (E)-9-[(1E,3Z)-nona-1,3-dienoxy]non-8-enoate |
| SMILES (Canonical) | CCCCCC=CC=COC=CCCCCCCC(=O)OC |
| SMILES (Isomeric) | CCCCC/C=C\C=C\O/C=C/CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-5-6-8-11-14-17-22-18-15-12-9-7-10-13-16-19(20)21-2/h8,11,14-15,17-18H,3-7,9-10,12-13,16H2,1-2H3/b11-8-,17-14+,18-15+ |
| InChI Key | BLNDDYNVUIBQFL-KSQKUNDXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
![2D Structure of methyl (E)-9-[(1E,3Z)-nona-1,3-dienoxy]non-8-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-e-9-1e3z-nona-13-dienoxynon-8-enoate.jpg "2D Structure of methyl (E)-9-[(1E,3Z)-nona-1,3-dienoxy]non-8-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.17% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.24% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.28% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 91.43% | 89.76% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.04% | 96.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.96% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.14% | 97.29% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.63% | 94.33% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.83% | 85.94% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.81% | 98.03% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.64% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.91% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.83% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.75% | 100.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.58% | 89.34% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.04% | 92.50% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.98% | 97.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.78% | 94.73% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 81.48% | 91.81% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 80.62% | 86.67% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.47% | 92.86% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.25% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Solanum tuberosum |
| PubChem | 13917536 |
| LOTUS | LTS0225292 |
| wikiData | Q104938072 |